![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | penny.it | 2017-06-11 22:58 | 23M | |
![[SND]](/icons/sound2.gif) | bung.it | 2020-08-26 19:55 | 13M | |
![[SND]](/icons/sound2.gif) | flarp.it | 2016-08-12 21:56 | 12M | |
![[SND]](/icons/sound2.gif) | bunger.it | 2021-02-07 19:53 | 11M | |
![[SND]](/icons/sound2.gif) | radial.it | 2013-12-12 20:54 | 11M | |
![[SND]](/icons/sound2.gif) | gulch.it | 2020-04-05 19:08 | 9.9M | |
![[SND]](/icons/sound2.gif) | lithopod.it | 2020-09-09 20:11 | 9.7M | |
![[SND]](/icons/sound2.gif) | those.it | 2018-06-01 21:42 | 9.6M | |
![[SND]](/icons/sound2.gif) | d-wave.it | 2020-06-14 19:48 | 9.4M | |
![[SND]](/icons/sound2.gif) | total request.it | 2019-03-16 07:35 | 9.4M | |
![[SND]](/icons/sound2.gif) | groods.it | 2016-03-11 21:25 | 9.1M | |
![[SND]](/icons/sound2.gif) | drimp.it | 2020-08-02 19:51 | 8.8M | |
![[SND]](/icons/sound2.gif) | sosumis.it | 2020-08-09 21:17 | 8.8M | |
![[SND]](/icons/sound2.gif) | garbl.it | 2016-12-09 21:06 | 8.7M | |
![[SND]](/icons/sound2.gif) | thermoshat.it | 2016-06-02 21:02 | 8.6M | |
![[SND]](/icons/sound2.gif) | thin_meal_pipe.it | 2017-10-20 21:12 | 8.5M | |
![[SND]](/icons/sound2.gif) | gyudon.it | 2017-04-07 21:14 | 8.5M | |
![[SND]](/icons/sound2.gif) | a9.it | 2020-08-19 19:48 | 8.5M | |
![[SND]](/icons/sound2.gif) | skeletonsman.it | 2017-01-20 21:17 | 8.2M | |
![[SND]](/icons/sound2.gif) | squirty.it | 2018-05-18 21:16 | 7.9M | |
![[SND]](/icons/sound2.gif) | mirrp.it | 2016-12-30 20:54 | 7.8M | |
![[SND]](/icons/sound2.gif) | game_oil.it | 2017-03-24 21:08 | 7.8M | |
![[SND]](/icons/sound2.gif) | speeps.it | 2016-06-24 21:37 | 7.7M | |
![[SND]](/icons/sound2.gif) | heavydoodle.it | 2013-12-27 13:50 | 7.7M | |
![[SND]](/icons/sound2.gif) | pug_school.it | 2017-09-15 21:11 | 7.7M | |
![[SND]](/icons/sound2.gif) | einhorn.it | 2016-10-14 21:36 | 7.7M | |
![[SND]](/icons/sound2.gif) | whoap.it | 2016-12-02 22:10 | 7.6M | |
![[SND]](/icons/sound2.gif) | ican.it | 2018-07-27 21:22 | 7.6M | |
![[SND]](/icons/sound2.gif) | worbing.it | 2017-01-06 21:31 | 7.5M | |
![[SND]](/icons/sound2.gif) | robotus.it | 2014-05-22 19:36 | 7.4M | |
![[SND]](/icons/sound2.gif) | wompo.it | 2018-11-26 00:18 | 7.4M | |
![[SND]](/icons/sound2.gif) | drep.it | 2017-06-02 21:13 | 7.2M | |
![[SND]](/icons/sound2.gif) | computer combat.it | 2017-07-28 22:28 | 7.1M | |
![[SND]](/icons/sound2.gif) | tert.it | 2020-09-02 20:12 | 7.0M | |
![[SND]](/icons/sound2.gif) | rumpus_room.it | 2016-05-05 21:49 | 7.0M | |
![[SND]](/icons/sound2.gif) | sharepea.it | 2016-07-07 21:17 | 6.8M | |
![[SND]](/icons/sound2.gif) | oboe.it | 2020-07-12 19:46 | 6.8M | |
![[SND]](/icons/sound2.gif) | chooger.it | 2016-09-02 21:53 | 6.7M | |
![[SND]](/icons/sound2.gif) | dirtdoor.it | 2020-03-29 19:07 | 6.6M | |
![[SND]](/icons/sound2.gif) | fournotes.it | 2016-02-05 21:14 | 6.6M | |
![[SND]](/icons/sound2.gif) | gridlime.it | 2021-01-24 19:31 | 6.6M | |
![[SND]](/icons/sound2.gif) | muhh.it | 2020-04-17 19:04 | 6.4M | |
![[SND]](/icons/sound2.gif) | robusto.it | 2014-05-23 20:23 | 6.4M | |
![[SND]](/icons/sound2.gif) | small_bennis.it | 2020-12-20 19:48 | 6.3M | |
![[SND]](/icons/sound2.gif) | snakedog.it | 2016-08-19 21:38 | 6.3M | |
![[SND]](/icons/sound2.gif) | dort.it | 2019-03-12 20:55 | 6.3M | |
![[SND]](/icons/sound2.gif) | dirt_creature.it | 2020-06-10 19:36 | 6.3M | |
![[SND]](/icons/sound2.gif) | crudd.it | 2019-09-03 20:45 | 6.2M | |
![[SND]](/icons/sound2.gif) | pastabeat.it | 2015-07-26 22:28 | 6.1M | |
![[SND]](/icons/sound2.gif) | extraloaf.it | 2015-05-29 21:24 | 6.0M | |
![[SND]](/icons/sound2.gif) | nopan.it | 2021-01-03 19:54 | 6.0M | |
![[SND]](/icons/sound2.gif) | bagg.it | 2020-06-28 19:53 | 5.9M | |
![[SND]](/icons/sound2.gif) | pitacrumbs.it | 2015-07-27 23:09 | 5.8M | |
![[SND]](/icons/sound2.gif) | strumburt.it | 2017-09-01 21:10 | 5.7M | |
![[SND]](/icons/sound2.gif) | scrubd.it | 2019-07-27 14:07 | 5.6M | |
![[SND]](/icons/sound2.gif) | wango.it | 2016-11-11 20:43 | 5.6M | |
![[SND]](/icons/sound2.gif) | eco.it | 2017-06-09 21:48 | 5.5M | |
![[SND]](/icons/sound2.gif) | grundix2.it | 2016-01-04 17:11 | 5.5M | |
![[SND]](/icons/sound2.gif) | cadencedog.it | 2015-08-01 22:17 | 5.4M | |
![[SND]](/icons/sound2.gif) | cheemoes.it | 2016-06-23 21:16 | 5.4M | |
![[SND]](/icons/sound2.gif) | small_tub.it | 2016-02-26 23:02 | 5.3M | |
![[SND]](/icons/sound2.gif) | cupler.it | 2016-05-19 21:30 | 5.1M | |
![[SND]](/icons/sound2.gif) | cardboard grease.it | 2017-09-08 21:04 | 5.1M | |
![[SND]](/icons/sound2.gif) | croako.it | 2016-07-14 21:20 | 5.1M | |
![[SND]](/icons/sound2.gif) | cloaked_egg.it | 2016-05-20 21:26 | 5.0M | |
![[SND]](/icons/sound2.gif) | liquid_bean.it | 2016-05-06 21:50 | 5.0M | |
![[SND]](/icons/sound2.gif) | foo.it | 2020-10-18 19:44 | 5.0M | |
![[SND]](/icons/sound2.gif) | wonono.it | 2015-06-05 21:08 | 4.9M | |
![[SND]](/icons/sound2.gif) | dizzard.it | 2017-04-14 21:18 | 4.8M | |
![[SND]](/icons/sound2.gif) | starts_in_2m.it | 2021-10-23 12:33 | 4.8M | |
![[SND]](/icons/sound2.gif) | earl.it | 2012-07-03 18:12 | 4.8M | |
![[SND]](/icons/sound2.gif) | droughp.it | 2020-04-07 19:22 | 4.7M | |
![[SND]](/icons/sound2.gif) | dudes.it | 2024-12-14 10:28 | 4.5M | |
![[SND]](/icons/sound2.gif) | nutstrats.it | 2020-12-27 19:44 | 4.5M | |
![[SND]](/icons/sound2.gif) | dooba.it | 2016-01-08 22:22 | 4.4M | |
![[SND]](/icons/sound2.gif) | sprink.it | 2016-08-27 00:33 | 4.4M | |
![[SND]](/icons/sound2.gif) | microdogs.it | 2015-07-17 21:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | starto.it | 2021-04-14 17:58 | 4.3M | |
![[SND]](/icons/sound2.gif) | starzipper.it | 2015-07-31 21:56 | 4.3M | |
![[SND]](/icons/sound2.gif) | artisanal.it | 2015-07-26 22:02 | 4.3M | |
![[SND]](/icons/sound2.gif) | maplo.it | 2020-04-02 19:13 | 4.3M | |
![[SND]](/icons/sound2.gif) | europe.it | 2020-05-24 19:38 | 4.2M | |
![[SND]](/icons/sound2.gif) | ball_off.it | 2020-07-19 13:04 | 4.2M | |
![[SND]](/icons/sound2.gif) | coda.it | 2021-11-19 21:39 | 4.2M | |
![[SND]](/icons/sound2.gif) | bugplanet.it | 2013-11-30 20:38 | 4.2M | |
![[SND]](/icons/sound2.gif) | coolpair.it | 2014-09-12 20:56 | 4.1M | |
![[SND]](/icons/sound2.gif) | cool ranch cat litter.it | 2020-09-23 20:04 | 4.0M | |
![[SND]](/icons/sound2.gif) | cuckus.it | 2016-02-01 21:45 | 4.0M | |
![[SND]](/icons/sound2.gif) | fiveroat.it | 2016-12-21 21:48 | 3.9M | |
![[SND]](/icons/sound2.gif) | shortleg.it | 2016-10-07 22:03 | 3.9M | |
![[SND]](/icons/sound2.gif) | onemore.it | 2022-10-15 10:33 | 3.9M | |
![[SND]](/icons/sound2.gif) | shovelmaster.it | 2020-04-16 18:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | deepnugs.it | 2016-01-20 21:38 | 3.8M | |
![[SND]](/icons/sound2.gif) | remix.it | 2012-07-20 18:42 | 3.8M | |
![[SND]](/icons/sound2.gif) | stinktrum.it | 2016-02-04 21:27 | 3.8M | |
![[SND]](/icons/sound2.gif) | knifacrack.it | 2010-05-02 21:13 | 3.8M | |
![[SND]](/icons/sound2.gif) | bingusus.it | 2022-02-16 18:51 | 3.8M | |
![[SND]](/icons/sound2.gif) | shard.it | 2020-04-09 19:20 | 3.6M | |
![[SND]](/icons/sound2.gif) | midibooner.it | 2015-12-13 00:11 | 3.6M | |
![[SND]](/icons/sound2.gif) | whoup.it | 2016-09-16 21:54 | 3.6M | |
![[SND]](/icons/sound2.gif) | sneakdad.it | 2015-09-11 21:56 | 3.6M | |
![[SND]](/icons/sound2.gif) | ya.it | 2020-04-13 19:23 | 3.5M | |
![[SND]](/icons/sound2.gif) | beppu.it | 2016-01-08 20:08 | 3.5M | |
![[SND]](/icons/sound2.gif) | bridged.it | 2020-04-19 13:07 | 3.5M | |
![[SND]](/icons/sound2.gif) | toe.it | 2019-03-19 20:44 | 3.5M | |
![[SND]](/icons/sound2.gif) | dogxchg.it | 2016-04-29 23:30 | 3.5M | |
![[SND]](/icons/sound2.gif) | unlucky.it | 2014-03-07 16:43 | 3.5M | |
![[SND]](/icons/sound2.gif) | mooka.it | 2024-04-07 20:25 | 3.5M | |
![[SND]](/icons/sound2.gif) | jellyzoo.it | 2015-09-04 22:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | chicken finger probe.it | 2015-08-28 21:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | stonko.it | 2020-11-24 18:31 | 3.4M | |
![[SND]](/icons/sound2.gif) | ducking.it | 2015-11-13 22:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | hampurgers.it | 2019-03-26 20:44 | 3.4M | |
![[SND]](/icons/sound2.gif) | stuft.it | 2015-06-26 21:45 | 3.3M | |
![[SND]](/icons/sound2.gif) | worldman.it | 2015-05-17 22:37 | 3.3M | |
![[SND]](/icons/sound2.gif) | remoulador.it | 2015-05-22 21:35 | 3.3M | |
![[SND]](/icons/sound2.gif) | rogs.it | 2016-11-18 22:02 | 3.3M | |
![[SND]](/icons/sound2.gif) | deeg.it | 2020-06-07 19:33 | 3.3M | |
![[SND]](/icons/sound2.gif) | idonotlike.it | 2020-05-17 19:36 | 3.3M | |
![[SND]](/icons/sound2.gif) | piezocake.it | 2015-02-28 13:59 | 3.3M | |
![[SND]](/icons/sound2.gif) | burgercoin.it | 2021-01-31 19:53 | 3.2M | |
![[SND]](/icons/sound2.gif) | peebs.it | 2015-05-31 21:43 | 3.2M | |
![[SND]](/icons/sound2.gif) | crowdclown.it | 2016-09-09 21:48 | 3.2M | |
![[SND]](/icons/sound2.gif) | moo.it | 2015-08-21 23:42 | 3.2M | |
![[SND]](/icons/sound2.gif) | wole.it | 2020-04-18 13:11 | 3.2M | |
![[SND]](/icons/sound2.gif) | haah.it | 2016-09-23 22:16 | 3.1M | |
![[SND]](/icons/sound2.gif) | retire.it | 2012-07-09 18:14 | 3.1M | |
![[SND]](/icons/sound2.gif) | jd.it | 2012-07-05 20:19 | 3.1M | |
![[SND]](/icons/sound2.gif) | greazin.it | 2016-01-09 11:48 | 3.1M | |
![[SND]](/icons/sound2.gif) | woam.it | 2020-03-29 13:03 | 3.1M | |
![[SND]](/icons/sound2.gif) | tringler.it | 2015-07-28 22:30 | 3.1M | |
![[SND]](/icons/sound2.gif) | sixpack.it | 2012-07-14 20:17 | 3.0M | |
![[SND]](/icons/sound2.gif) | brainus.it | 2021-01-17 21:10 | 3.0M | |
![[SND]](/icons/sound2.gif) | milpitas.it | 2013-01-18 22:01 | 3.0M | |
![[SND]](/icons/sound2.gif) | youc.it | 2008-06-17 19:55 | 3.0M | |
![[SND]](/icons/sound2.gif) | rballs.it | 2012-11-16 19:07 | 3.0M | |
![[SND]](/icons/sound2.gif) | scrampy.it | 2020-05-31 19:29 | 3.0M | |
![[SND]](/icons/sound2.gif) | glueb.it | 2012-06-28 20:15 | 2.9M | |
![[SND]](/icons/sound2.gif) | roller.it | 2020-06-07 13:06 | 2.9M | |
![[SND]](/icons/sound2.gif) | bubbo.it | 2017-06-16 21:21 | 2.9M | |
![[SND]](/icons/sound2.gif) | balogey.it | 2015-07-27 21:40 | 2.9M | |
![[SND]](/icons/sound2.gif) | daycare.it | 2012-08-14 18:15 | 2.9M | |
![[SND]](/icons/sound2.gif) | lasagna.it | 2020-05-13 19:40 | 2.9M | |
![[SND]](/icons/sound2.gif) | lizard_dust.it | 2017-07-29 13:54 | 2.9M | |
![[SND]](/icons/sound2.gif) | smawk.it | 2022-06-17 14:57 | 2.9M | |
![[SND]](/icons/sound2.gif) | nusty.it | 2023-12-09 14:29 | 2.9M | |
![[SND]](/icons/sound2.gif) | process.it | 2012-07-11 20:15 | 2.8M | |
![[SND]](/icons/sound2.gif) | joyrider.it | 2012-07-07 14:10 | 2.8M | |
![[SND]](/icons/sound2.gif) | cola.it | 2020-05-10 13:08 | 2.8M | |
![[SND]](/icons/sound2.gif) | meridian.it | 2020-12-30 13:03 | 2.8M | |
![[SND]](/icons/sound2.gif) | durfy.it | 2017-06-30 20:42 | 2.8M | |
![[SND]](/icons/sound2.gif) | dayjob.it | 2019-05-18 14:06 | 2.8M | |
![[SND]](/icons/sound2.gif) | prince_limabeans.it | 2013-02-15 20:15 | 2.7M | |
![[SND]](/icons/sound2.gif) | timber.it | 2012-07-26 20:49 | 2.7M | |
![[SND]](/icons/sound2.gif) | screaming at the squat rack.it | 2019-03-06 14:51 | 2.7M | |
![[SND]](/icons/sound2.gif) | nstar.it | 2013-02-08 23:13 | 2.7M | |
![[SND]](/icons/sound2.gif) | mediaplayer.it | 2020-06-03 19:39 | 2.7M | |
![[SND]](/icons/sound2.gif) | pengi.it | 2024-10-13 13:07 | 2.7M | |
![[SND]](/icons/sound2.gif) | power.it | 2020-03-22 14:05 | 2.7M | |
![[SND]](/icons/sound2.gif) | ronaldinhokart.it | 2020-05-07 08:17 | 2.7M | |
![[SND]](/icons/sound2.gif) | salted.it | 2013-01-16 17:12 | 2.7M | |
![[SND]](/icons/sound2.gif) | goatos.it | 2020-06-02 15:52 | 2.7M | |
![[SND]](/icons/sound2.gif) | gethugly.it | 2014-05-20 19:22 | 2.6M | |
![[SND]](/icons/sound2.gif) | hi5.it | 2012-07-06 20:00 | 2.6M | |
![[SND]](/icons/sound2.gif) | mininut.it | 2014-05-23 23:13 | 2.6M | |
![[SND]](/icons/sound2.gif) | hellow.it | 2013-11-30 16:46 | 2.6M | |
![[SND]](/icons/sound2.gif) | timeruler.it | 2012-08-05 18:49 | 2.6M | |
![[SND]](/icons/sound2.gif) | namemydog.it | 2012-07-19 18:35 | 2.6M | |
![[SND]](/icons/sound2.gif) | lightrain.it | 2010-02-12 21:02 | 2.6M | |
![[SND]](/icons/sound2.gif) | fbalance.it | 2012-12-21 21:05 | 2.6M | |
![[SND]](/icons/sound2.gif) | casks.it | 2012-07-22 17:55 | 2.5M | |
![[SND]](/icons/sound2.gif) | catlow.it | 2015-07-24 22:44 | 2.5M | |
![[SND]](/icons/sound2.gif) | mixxus.it | 2012-07-18 18:16 | 2.5M | |
![[SND]](/icons/sound2.gif) | mayo.it | 2012-07-31 18:10 | 2.5M | |
![[SND]](/icons/sound2.gif) | chirale.it | 2020-10-18 13:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | brushed.it | 2020-01-18 14:06 | 2.5M | |
![[SND]](/icons/sound2.gif) | inside lotus.it | 2020-11-26 19:57 | 2.4M | |
![[SND]](/icons/sound2.gif) | chust.it | 2019-12-14 14:15 | 2.4M | |
![[SND]](/icons/sound2.gif) | repacked.it | 2020-05-03 13:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | reel2.it | 2012-08-06 18:17 | 2.4M | |
![[SND]](/icons/sound2.gif) | gold.it | 2013-01-15 20:26 | 2.4M | |
![[SND]](/icons/sound2.gif) | it.it | 2021-10-24 13:08 | 2.4M | |
![[SND]](/icons/sound2.gif) | garbagefishing.it | 2016-01-12 13:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | dingu.it | 2016-11-04 21:29 | 2.4M | |
![[SND]](/icons/sound2.gif) | excess.it | 2012-07-10 20:17 | 2.4M | |
![[SND]](/icons/sound2.gif) | eggshoes.it | 2015-08-14 22:05 | 2.4M | |
![[SND]](/icons/sound2.gif) | thin_frank.it | 2013-01-09 00:43 | 2.4M | |
![[SND]](/icons/sound2.gif) | brazil.it | 2013-01-29 00:10 | 2.4M | |
![[SND]](/icons/sound2.gif) | wex.it | 2020-07-01 19:56 | 2.4M | |
![[SND]](/icons/sound2.gif) | higgins.it | 2012-07-16 19:53 | 2.4M | |
![[SND]](/icons/sound2.gif) | prohog.it | 2015-01-10 19:58 | 2.3M | |
![[SND]](/icons/sound2.gif) | inordered.it | 2012-08-11 20:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | nutjacked.it | 2016-02-27 13:50 | 2.3M | |
![[SND]](/icons/sound2.gif) | average.it | 2021-09-12 13:16 | 2.3M | |
![[SND]](/icons/sound2.gif) | beekler.it | 2019-03-02 14:05 | 2.3M | |
![[SND]](/icons/sound2.gif) | melton.it | 2020-08-16 13:07 | 2.3M | |
![[SND]](/icons/sound2.gif) | snakeflower.it | 2014-09-06 14:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | quant.it | 2013-02-05 23:07 | 2.3M | |
![[SND]](/icons/sound2.gif) | floon.it | 2012-08-08 18:11 | 2.3M | |
![[SND]](/icons/sound2.gif) | gaogeneration.it | 2012-08-10 18:17 | 2.3M | |
![[SND]](/icons/sound2.gif) | formation.it | 2012-07-30 20:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | shrimp.it | 2021-04-13 16:42 | 2.2M | |
![[SND]](/icons/sound2.gif) | palate.it | 2013-02-21 21:54 | 2.2M | |
![[SND]](/icons/sound2.gif) | aligned.it | 2015-08-22 14:38 | 2.2M | |
![[SND]](/icons/sound2.gif) | updog.it | 2012-06-20 19:24 | 2.2M | |
![[SND]](/icons/sound2.gif) | zeri.it | 2012-06-26 20:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | nutmatter.it | 2015-07-10 21:43 | 2.2M | |
![[SND]](/icons/sound2.gif) | afterburn2.it | 2014-08-23 14:10 | 2.2M | |
![[SND]](/icons/sound2.gif) | sidegoat.it | 2011-10-24 21:56 | 2.2M | |
![[SND]](/icons/sound2.gif) | struggleman.it | 2015-12-11 21:24 | 2.2M | |
![[SND]](/icons/sound2.gif) | morg.it | 2008-02-18 20:14 | 2.2M | |
![[SND]](/icons/sound2.gif) | bimpin.it | 2012-07-08 18:15 | 2.2M | |
![[SND]](/icons/sound2.gif) | nullph.it | 2012-08-24 21:53 | 2.2M | |
![[SND]](/icons/sound2.gif) | crawl.it | 2019-05-25 14:15 | 2.2M | |
![[SND]](/icons/sound2.gif) | ohh_ok.it | 2021-03-07 13:11 | 2.2M | |
![[SND]](/icons/sound2.gif) | unstick.it | 2020-04-26 12:56 | 2.2M | |
![[SND]](/icons/sound2.gif) | pano.it | 2016-11-19 12:15 | 2.2M | |
![[SND]](/icons/sound2.gif) | crysco.it | 2021-11-28 13:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | hue.it | 2012-09-27 21:11 | 2.1M | |
![[SND]](/icons/sound2.gif) | lunchstyle.it | 2016-03-19 15:14 | 2.1M | |
![[SND]](/icons/sound2.gif) | dankstar.it | 2015-05-29 23:43 | 2.1M | |
![[SND]](/icons/sound2.gif) | mildsauce.it | 2020-11-01 13:07 | 2.1M | |
![[SND]](/icons/sound2.gif) | disregard.it | 2012-08-07 20:44 | 2.1M | |
![[SND]](/icons/sound2.gif) | sporastic.it | 2020-04-05 13:07 | 2.1M | |
![[SND]](/icons/sound2.gif) | danko.it | 2015-10-30 21:21 | 2.1M | |
![[SND]](/icons/sound2.gif) | dick.it | 2010-11-05 10:34 | 2.1M | |
![[SND]](/icons/sound2.gif) | hydrohol.it | 2020-03-01 13:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | smust.it | 2020-09-13 12:50 | 2.1M | |
![[SND]](/icons/sound2.gif) | debt.it | 2012-08-01 20:33 | 2.1M | |
![[SND]](/icons/sound2.gif) | stretchy.it | 2021-10-17 13:05 | 2.1M | |
![[SND]](/icons/sound2.gif) | cure.it | 2024-03-03 13:21 | 2.1M | |
![[SND]](/icons/sound2.gif) | digber.it | 2016-12-31 14:12 | 2.1M | |
![[SND]](/icons/sound2.gif) | akita.it | 2012-06-29 20:11 | 2.1M | |
![[SND]](/icons/sound2.gif) | shit31.it | 2021-10-31 14:05 | 2.1M | |
![[SND]](/icons/sound2.gif) | kuri.it | 2012-07-08 17:31 | 2.0M | |
![[SND]](/icons/sound2.gif) | many.it | 2010-11-05 18:14 | 2.0M | |
![[SND]](/icons/sound2.gif) | online.it | 2015-07-11 14:13 | 2.0M | |
![[SND]](/icons/sound2.gif) | paratoot.it | 2016-07-16 14:08 | 2.0M | |
![[SND]](/icons/sound2.gif) | cheesebattle.it | 2012-08-03 20:45 | 2.0M | |
![[SND]](/icons/sound2.gif) | pocean.it | 2020-03-15 14:07 | 2.0M | |
![[SND]](/icons/sound2.gif) | schnitz.it | 2018-06-09 14:07 | 2.0M | |
![[SND]](/icons/sound2.gif) | essential.it | 2020-01-20 11:34 | 2.0M | |
![[SND]](/icons/sound2.gif) | resetly.it | 2015-10-24 14:19 | 2.0M | |
![[SND]](/icons/sound2.gif) | final_lap.it | 2018-11-10 14:03 | 2.0M | |
![[SND]](/icons/sound2.gif) | intake.it | 2012-08-04 23:08 | 2.0M | |
![[SND]](/icons/sound2.gif) | slide.it | 2024-05-23 12:01 | 2.0M | |
![[SND]](/icons/sound2.gif) | hairgoat.it | 2013-11-13 15:14 | 2.0M | |
![[SND]](/icons/sound2.gif) | oblique.it | 2020-09-20 13:04 | 2.0M | |
![[SND]](/icons/sound2.gif) | vocalite.it | 2020-08-02 13:06 | 2.0M | |
![[SND]](/icons/sound2.gif) | dark_farming.it | 2018-06-02 14:04 | 2.0M | |
![[SND]](/icons/sound2.gif) | flz.it | 2017-09-02 14:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | wheatbrain.it | 2012-08-12 18:15 | 2.0M | |
![[SND]](/icons/sound2.gif) | paradise.it | 2008-09-20 22:41 | 2.0M | |
![[SND]](/icons/sound2.gif) | sussly.it | 2016-11-05 15:20 | 2.0M | |
![[SND]](/icons/sound2.gif) | horsey.it | 2015-07-17 23:44 | 2.0M | |
![[SND]](/icons/sound2.gif) | lower.it | 2017-06-03 13:49 | 2.0M | |
![[SND]](/icons/sound2.gif) | rewerb.it | 2018-04-22 16:27 | 2.0M | |
![[SND]](/icons/sound2.gif) | sausagestory.it | 2012-12-15 20:44 | 2.0M | |
![[SND]](/icons/sound2.gif) | postrophe.it | 2021-09-19 13:41 | 2.0M | |
![[SND]](/icons/sound2.gif) | crumpin.it | 2014-05-20 21:29 | 1.9M | |
![[SND]](/icons/sound2.gif) | wich_doctor.it | 2021-02-28 13:01 | 1.9M | |
![[SND]](/icons/sound2.gif) | paranorm.it | 2017-05-13 14:00 | 1.9M | |
![[SND]](/icons/sound2.gif) | shredup.it | 2015-03-07 13:59 | 1.9M | |
![[SND]](/icons/sound2.gif) | scrunk.it | 2012-07-25 20:37 | 1.9M | |
![[SND]](/icons/sound2.gif) | slopey.it | 2015-11-14 14:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | nonvege.it | 2008-06-13 20:23 | 1.9M | |
![[SND]](/icons/sound2.gif) | skeletonlinks.it | 2016-04-23 14:08 | 1.9M | |
![[SND]](/icons/sound2.gif) | stankroom.it | 2015-06-12 21:34 | 1.9M | |
![[SND]](/icons/sound2.gif) | videogames.it | 2013-01-29 02:06 | 1.9M | |
![[SND]](/icons/sound2.gif) | hoozle.it | 2015-05-30 14:11 | 1.9M | |
![[SND]](/icons/sound2.gif) | secret_trance.it | 2010-06-03 21:42 | 1.9M | |
![[SND]](/icons/sound2.gif) | impulse.it | 2014-05-26 16:27 | 1.9M | |
![[SND]](/icons/sound2.gif) | house.flac.it | 2021-03-28 13:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | ffiii-2.it | 2012-07-29 20:03 | 1.9M | |
![[SND]](/icons/sound2.gif) | guack.it | 2012-07-02 18:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | drumpet.it | 2021-01-24 12:59 | 1.9M | |
![[SND]](/icons/sound2.gif) | crownut.it | 2014-12-06 14:08 | 1.9M | |
![[SND]](/icons/sound2.gif) | floret.it | 2012-10-12 18:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | cshaped.it | 2020-05-17 12:57 | 1.9M | |
![[SND]](/icons/sound2.gif) | somethings.it | 2021-05-23 13:06 | 1.9M | |
![[SND]](/icons/sound2.gif) | corned.it | 2012-08-10 20:39 | 1.9M | |
![[SND]](/icons/sound2.gif) | greastly.it | 2016-01-23 14:05 | 1.9M | |
![[SND]](/icons/sound2.gif) | dubu.it | 2016-03-16 21:18 | 1.9M | |
![[SND]](/icons/sound2.gif) | brank.it | 2020-12-06 13:06 | 1.8M | |
![[SND]](/icons/sound2.gif) | doskprompt.it | 2020-08-30 13:02 | 1.8M | |
![[SND]](/icons/sound2.gif) | hookart.it | 2014-05-25 20:30 | 1.8M | |
![[SND]](/icons/sound2.gif) | meca.it | 2016-02-06 14:03 | 1.8M | |
![[SND]](/icons/sound2.gif) | 2006.it | 2010-04-11 21:19 | 1.8M | |
![[SND]](/icons/sound2.gif) | unwire.it | 2012-07-04 18:08 | 1.8M | |
![[SND]](/icons/sound2.gif) | deletethis.it | 2016-01-02 14:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | grulp.it | 2015-07-10 23:33 | 1.8M | |
![[SND]](/icons/sound2.gif) | ynot.it | 2015-09-26 15:11 | 1.8M | |
![[SND]](/icons/sound2.gif) | fisheria.it | 2015-11-28 14:36 | 1.8M | |
![[SND]](/icons/sound2.gif) | fwee.it | 2021-04-18 13:07 | 1.8M | |
![[SND]](/icons/sound2.gif) | microwave.it | 2022-01-09 13:08 | 1.8M | |
![[SND]](/icons/sound2.gif) | buggle.it | 2017-05-06 14:44 | 1.8M | |
![[SND]](/icons/sound2.gif) | chalupass.it | 2012-12-07 21:07 | 1.8M | |
![[SND]](/icons/sound2.gif) | turdance.it | 2021-10-05 01:20 | 1.8M | |
![[SND]](/icons/sound2.gif) | ack.it | 2018-07-28 14:08 | 1.8M | |
![[SND]](/icons/sound2.gif) | onionbros.it | 2015-07-25 14:25 | 1.8M | |
![[SND]](/icons/sound2.gif) | unradish.it | 2019-03-09 14:01 | 1.7M | |
![[SND]](/icons/sound2.gif) | wharf.it | 2014-05-19 21:42 | 1.7M | |
![[SND]](/icons/sound2.gif) | sadboyz.it | 2015-08-21 21:47 | 1.7M | |
![[SND]](/icons/sound2.gif) | guyphoto.it | 2012-07-29 20:03 | 1.7M | |
![[SND]](/icons/sound2.gif) | revibe.it | 2012-07-15 18:13 | 1.7M | |
![[SND]](/icons/sound2.gif) | princess_mayonnaise.it | 2013-12-14 22:45 | 1.7M | |
![[SND]](/icons/sound2.gif) | espis.it | 2024-01-21 13:08 | 1.7M | |
![[SND]](/icons/sound2.gif) | reclutter.it | 2022-04-03 13:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | calcutter.it | 2018-02-03 14:05 | 1.7M | |
![[SND]](/icons/sound2.gif) | tein.it | 2019-07-13 14:04 | 1.7M | |
![[SND]](/icons/sound2.gif) | icanttakeyouanywhere.it | 2012-04-04 23:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | nikkouland.it | 2012-02-14 20:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | bald.it | 2012-08-25 21:37 | 1.7M | |
![[SND]](/icons/sound2.gif) | dumpcake.it | 2015-06-20 14:27 | 1.7M | |
![[SND]](/icons/sound2.gif) | nubert.it | 2015-01-11 20:04 | 1.7M | |
![[SND]](/icons/sound2.gif) | social.it | 2012-07-27 18:08 | 1.7M | |
![[SND]](/icons/sound2.gif) | stage83.it | 2020-05-03 19:10 | 1.6M | |
![[SND]](/icons/sound2.gif) | dunk.it | 2015-05-15 21:16 | 1.6M | |
![[SND]](/icons/sound2.gif) | veh5.it | 2021-09-26 13:05 | 1.6M | |
![[SND]](/icons/sound2.gif) | quartlet.it | 2021-03-14 14:05 | 1.6M | |
![[SND]](/icons/sound2.gif) | dbenist.it | 2012-07-08 14:13 | 1.6M | |
![[SND]](/icons/sound2.gif) | newskill.it | 2009-05-22 20:03 | 1.6M | |
![[SND]](/icons/sound2.gif) | slashy.it | 2012-02-17 20:06 | 1.6M | |
![[SND]](/icons/sound2.gif) | consoquance.it | 2023-11-23 19:00 | 1.6M | |
![[SND]](/icons/sound2.gif) | incrementing.it | 2020-09-06 12:59 | 1.6M | |
![[SND]](/icons/sound2.gif) | elemon.it | 2013-12-28 15:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | denchy.it | 2021-02-27 11:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | butterfist.it | 2014-12-27 14:07 | 1.6M | |
![[SND]](/icons/sound2.gif) | raisin.it | 2012-07-22 11:35 | 1.6M | |
![[SND]](/icons/sound2.gif) | talktosnail.it | 2009-03-11 21:45 | 1.6M | |
![[SND]](/icons/sound2.gif) | gumi.it | 2012-04-08 20:53 | 1.6M | |
![[SND]](/icons/sound2.gif) | freshlette.it | 2020-12-13 13:08 | 1.5M | |
![[SND]](/icons/sound2.gif) | sodmg.it | 2012-02-11 19:26 | 1.5M | |
![[SND]](/icons/sound2.gif) | moster.it | 2023-02-05 13:03 | 1.5M | |
![[SND]](/icons/sound2.gif) | wooly.it | 2015-01-03 14:07 | 1.5M | |
![[SND]](/icons/sound2.gif) | shibbs.it | 2017-04-08 14:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | bard.it | 2013-01-10 17:34 | 1.5M | |
![[SND]](/icons/sound2.gif) | restret.it | 2021-12-05 13:01 | 1.5M | |
![[SND]](/icons/sound2.gif) | meanstreets.it | 2013-12-14 21:11 | 1.5M | |
![[SND]](/icons/sound2.gif) | jakejace.it | 2012-12-14 21:05 | 1.5M | |
![[SND]](/icons/sound2.gif) | jacket.it | 2014-07-12 16:28 | 1.5M | |
![[SND]](/icons/sound2.gif) | feelsweirdman.it | 2021-12-26 14:05 | 1.5M | |
![[SND]](/icons/sound2.gif) | peepp.it | 2020-06-28 13:08 | 1.5M | |
![[SND]](/icons/sound2.gif) | sweeten.it | 2015-07-04 14:49 | 1.5M | |
![[SND]](/icons/sound2.gif) | slowbee.it | 2012-07-23 20:20 | 1.5M | |
![[SND]](/icons/sound2.gif) | sheldon.it | 2012-07-21 22:27 | 1.5M | |
![[SND]](/icons/sound2.gif) | ant.it | 2008-06-20 21:18 | 1.5M | |
![[SND]](/icons/sound2.gif) | snowclap.it | 2015-10-10 14:08 | 1.5M | |
![[SND]](/icons/sound2.gif) | gridd.it | 2024-11-24 13:06 | 1.5M | |
![[SND]](/icons/sound2.gif) | saguaro.it | 2022-05-22 12:54 | 1.4M | |
![[SND]](/icons/sound2.gif) | donus.it | 2012-07-24 20:37 | 1.4M | |
![[SND]](/icons/sound2.gif) | yowerup.it | 2023-02-16 17:56 | 1.4M | |
![[SND]](/icons/sound2.gif) | half.it | 2024-09-08 13:05 | 1.4M | |
![[SND]](/icons/sound2.gif) | scrapper.it | 2012-08-31 20:03 | 1.4M | |
![[SND]](/icons/sound2.gif) | nutallic.it | 2021-12-12 13:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | buckstop.it | 2015-11-21 14:14 | 1.4M | |
![[SND]](/icons/sound2.gif) | grey.it | 2015-04-18 14:11 | 1.4M | |
![[SND]](/icons/sound2.gif) | meatmines.it | 2020-05-10 18:56 | 1.4M | |
![[SND]](/icons/sound2.gif) | delisparks.it | 2015-10-17 14:08 | 1.4M | |
![[SND]](/icons/sound2.gif) | yupe.it | 2022-06-12 12:43 | 1.4M | |
![[SND]](/icons/sound2.gif) | six.it | 2013-04-06 14:08 | 1.4M | |
![[SND]](/icons/sound2.gif) | hypercake.it | 2015-04-25 14:08 | 1.4M | |
![[SND]](/icons/sound2.gif) | slacking.it | 2015-01-17 14:22 | 1.4M | |
![[SND]](/icons/sound2.gif) | hookshot.it | 2020-06-21 13:06 | 1.4M | |
![[SND]](/icons/sound2.gif) | ponpon.it | 2009-01-31 23:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | feedme.it | 2014-04-26 14:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | cooter.it | 2014-01-24 15:22 | 1.3M | |
![[SND]](/icons/sound2.gif) | stage9.it | 2012-07-21 20:03 | 1.3M | |
![[SND]](/icons/sound2.gif) | duckfackin.it | 2009-01-26 15:26 | 1.3M | |
![[SND]](/icons/sound2.gif) | reduced.it | 2020-07-05 13:06 | 1.3M | |
![[SND]](/icons/sound2.gif) | littlepianist.it | 2012-12-15 14:30 | 1.3M | |
![[SND]](/icons/sound2.gif) | slimchub.it | 2013-12-21 14:40 | 1.3M | |
![[SND]](/icons/sound2.gif) | black.it | 2009-09-08 22:01 | 1.3M | |
![[SND]](/icons/sound2.gif) | shaturday.it | 2010-11-20 16:58 | 1.3M | |
![[SND]](/icons/sound2.gif) | postboned.it | 2014-11-22 14:36 | 1.3M | |
![[SND]](/icons/sound2.gif) | typee.it | 2024-08-25 13:06 | 1.3M | |
![[SND]](/icons/sound2.gif) | jam_sale.it | 2017-01-28 14:18 | 1.3M | |
![[SND]](/icons/sound2.gif) | tossedsalad.it | 2009-05-03 15:47 | 1.3M | |
![[SND]](/icons/sound2.gif) | micronoodle.it | 2017-02-04 13:53 | 1.3M | |
![[SND]](/icons/sound2.gif) | beluga.it | 2012-12-29 17:07 | 1.3M | |
![[SND]](/icons/sound2.gif) | jate.it | 2024-11-03 13:06 | 1.3M | |
![[SND]](/icons/sound2.gif) | gaybert.it | 2008-10-19 21:02 | 1.3M | |
![[SND]](/icons/sound2.gif) | pumpndump.it | 2015-07-31 23:44 | 1.3M | |
![[SND]](/icons/sound2.gif) | udu.it | 2016-10-22 13:49 | 1.3M | |
![[SND]](/icons/sound2.gif) | wifi.it | 2024-07-14 13:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | chengus.it | 2020-09-27 19:42 | 1.3M | |
![[SND]](/icons/sound2.gif) | timepenis.it | 2010-05-17 19:55 | 1.3M | |
![[SND]](/icons/sound2.gif) | chappy.it | 2013-01-17 22:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | drf.it | 2012-07-13 18:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | abode.it | 2023-02-20 18:00 | 1.2M | |
![[SND]](/icons/sound2.gif) | laserwash.it | 2012-07-21 17:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | homeroom.it | 2015-01-31 14:10 | 1.2M | |
![[SND]](/icons/sound2.gif) | underweather.it | 2015-03-28 15:02 | 1.2M | |
![[SND]](/icons/sound2.gif) | sass.it | 2013-01-29 06:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | clbuttical.it | 2008-07-12 21:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | letsync.it | 2012-11-10 17:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | unpack.it | 2024-09-29 13:04 | 1.2M | |
![[SND]](/icons/sound2.gif) | gerald.it | 2014-11-01 15:00 | 1.2M | |
![[SND]](/icons/sound2.gif) | myspats.it | 2012-07-13 13:42 | 1.2M | |
![[SND]](/icons/sound2.gif) | fatpool.it | 2011-07-25 21:12 | 1.2M | |
![[SND]](/icons/sound2.gif) | promenade.it | 2010-08-20 23:32 | 1.2M | |
![[SND]](/icons/sound2.gif) | groabe.it | 2013-01-17 20:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | backseat.it | 2015-10-31 15:25 | 1.2M | |
![[SND]](/icons/sound2.gif) | woshi.it | 2022-11-06 13:00 | 1.2M | |
![[SND]](/icons/sound2.gif) | slobby.it | 2015-01-10 14:10 | 1.2M | |
![[SND]](/icons/sound2.gif) | echole.it | 2024-06-16 12:57 | 1.2M | |
![[SND]](/icons/sound2.gif) | subweed.it | 2015-05-22 23:46 | 1.2M | |
![[SND]](/icons/sound2.gif) | bleet.it | 2019-02-02 14:06 | 1.1M | |
![[SND]](/icons/sound2.gif) | mixler.it | 2015-03-14 15:10 | 1.1M | |
![[SND]](/icons/sound2.gif) | sickdrop.it | 2013-12-21 16:19 | 1.1M | |
![[SND]](/icons/sound2.gif) | monkey.it | 2020-04-29 19:14 | 1.1M | |
![[SND]](/icons/sound2.gif) | pfashion.it | 2009-06-20 14:47 | 1.1M | |
![[SND]](/icons/sound2.gif) | altered.it | 2009-07-25 21:30 | 1.1M | |
![[SND]](/icons/sound2.gif) | elmer.it | 2023-02-06 17:59 | 1.1M | |
![[SND]](/icons/sound2.gif) | how2count.it | 2012-02-15 17:59 | 1.1M | |
![[SND]](/icons/sound2.gif) | halted.it | 2023-03-12 13:39 | 1.1M | |
![[SND]](/icons/sound2.gif) | dots.it | 2013-06-29 14:06 | 1.1M | |
![[SND]](/icons/sound2.gif) | fowl.it | 2022-05-01 13:06 | 1.1M | |
![[SND]](/icons/sound2.gif) | cycle.it | 2024-11-17 13:06 | 1.1M | |
![[SND]](/icons/sound2.gif) | sacks.it | 2012-07-17 20:10 | 1.1M | |
![[SND]](/icons/sound2.gif) | granoladog.it | 2014-08-30 14:08 | 1.1M | |
![[SND]](/icons/sound2.gif) | munchers.it | 2009-02-10 21:05 | 1.1M | |
![[SND]](/icons/sound2.gif) | innocent.it | 2010-06-07 21:46 | 1.1M | |
![[SND]](/icons/sound2.gif) | upgraded.it | 2014-07-26 14:47 | 1.1M | |
![[SND]](/icons/sound2.gif) | rere.it | 2015-05-23 14:12 | 1.1M | |
![[SND]](/icons/sound2.gif) | shambhala.it | 2010-08-23 13:38 | 1.1M | |
![[SND]](/icons/sound2.gif) | boopus.it | 2016-09-24 15:41 | 1.1M | |
![[SND]](/icons/sound2.gif) | darklog.it | 2013-01-19 00:57 | 1.1M | |
![[SND]](/icons/sound2.gif) | groast.it | 2012-07-01 17:57 | 1.0M | |
![[SND]](/icons/sound2.gif) | olivegang.it | 2012-12-23 01:30 | 1.0M | |
![[SND]](/icons/sound2.gif) | haxcanyon.it | 2010-07-02 23:16 | 1.0M | |
![[SND]](/icons/sound2.gif) | double.it | 2009-01-06 19:33 | 1.0M | |
![[SND]](/icons/sound2.gif) | crustie.it | 2010-09-11 16:50 | 1.0M | |
![[SND]](/icons/sound2.gif) | dilk.it | 2023-11-22 15:16 | 1.0M | |
![[SND]](/icons/sound2.gif) | peetus.it | 2015-08-15 14:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dobut.it | 2013-11-16 14:11 | 1.0M | |
![[SND]](/icons/sound2.gif) | affect.it | 2023-08-13 12:57 | 1.0M | |
![[SND]](/icons/sound2.gif) | brnstain.it | 2012-08-13 20:37 | 1.0M | |
![[SND]](/icons/sound2.gif) | slimp.it | 2023-08-27 13:06 | 1.0M | |
![[SND]](/icons/sound2.gif) | graigg.it | 2017-09-30 14:02 | 1.0M | |
![[SND]](/icons/sound2.gif) | macaronis.it | 2011-05-11 21:03 | 1.0M | |
![[SND]](/icons/sound2.gif) | scroldum.it | 2023-02-08 18:00 | 1.0M | |
![[SND]](/icons/sound2.gif) | scrapy.it | 2022-09-11 12:47 | 1.0M | |
![[SND]](/icons/sound2.gif) | gambits.it | 2010-02-27 17:00 | 1.0M | |
![[SND]](/icons/sound2.gif) | strurst.it | 2022-11-13 13:14 | 1.0M | |
![[SND]](/icons/sound2.gif) | fiveidols.it | 2009-01-25 13:37 | 1.0M | |
![[SND]](/icons/sound2.gif) | strank.it | 2023-02-10 17:51 | 1.0M | |
![[SND]](/icons/sound2.gif) | whee.it | 2009-07-05 17:34 | 1.0M | |
![[SND]](/icons/sound2.gif) | grent.it | 2014-09-12 23:29 | 1.0M | |
![[SND]](/icons/sound2.gif) | xnuttus.it | 2016-01-11 11:10 | 1.0M | |
![[SND]](/icons/sound2.gif) | slicksub.it | 2009-09-19 20:07 | 1.0M | |
![[SND]](/icons/sound2.gif) | progdog.it | 2013-01-15 21:53 | 1.0M | |
![[SND]](/icons/sound2.gif) | rtf.it | 2008-06-16 17:15 | 972K | |
![[SND]](/icons/sound2.gif) | rumpd.it | 2014-10-25 14:07 | 961K | |
![[SND]](/icons/sound2.gif) | sunc.it | 2022-01-30 13:03 | 960K | |
![[SND]](/icons/sound2.gif) | nade.it | 2014-08-02 14:13 | 960K | |
![[SND]](/icons/sound2.gif) | shadows.it | 2012-11-03 17:07 | 958K | |
![[SND]](/icons/sound2.gif) | syncshot.it | 2011-06-04 19:21 | 958K | |
![[SND]](/icons/sound2.gif) | crope.it | 2023-02-14 17:54 | 952K | |
![[SND]](/icons/sound2.gif) | giant_pringle.it | 2022-02-27 13:06 | 941K | |
![[SND]](/icons/sound2.gif) | criatura.it | 2014-09-13 14:38 | 940K | |
![[SND]](/icons/sound2.gif) | puppeteer.it | 2012-12-12 22:22 | 933K | |
![[SND]](/icons/sound2.gif) | malibudux.it | 2010-06-06 19:31 | 933K | |
![[SND]](/icons/sound2.gif) | meltaway.it | 2014-04-19 14:04 | 926K | |
![[SND]](/icons/sound2.gif) | zoon.it | 2023-01-01 13:02 | 924K | |
![[SND]](/icons/sound2.gif) | cue.it | 2013-07-20 14:13 | 923K | |
![[SND]](/icons/sound2.gif) | trasm.it | 2022-05-08 12:34 | 922K | |
![[SND]](/icons/sound2.gif) | furbyburger.it | 2012-12-23 21:07 | 922K | |
![[SND]](/icons/sound2.gif) | wafer.it | 2010-05-18 17:34 | 919K | |
![[SND]](/icons/sound2.gif) | deboot.it | 2023-07-23 12:58 | 916K | |
![[SND]](/icons/sound2.gif) | awoogah.it | 2008-05-17 13:30 | 912K | |
![[SND]](/icons/sound2.gif) | oopy.it | 2010-07-09 14:24 | 909K | |
![[SND]](/icons/sound2.gif) | munyu.it | 2012-04-21 17:07 | 903K | |
![[SND]](/icons/sound2.gif) | iyasu.it | 2012-08-25 17:09 | 901K | |
![[SND]](/icons/sound2.gif) | nodulez.it | 2012-06-23 16:35 | 899K | |
![[SND]](/icons/sound2.gif) | gaggle.it | 2009-09-24 22:02 | 897K | |
![[SND]](/icons/sound2.gif) | suncall.it | 2013-10-12 14:43 | 895K | |
![[SND]](/icons/sound2.gif) | slapnuts64.it | 2010-06-02 21:51 | 881K | |
![[SND]](/icons/sound2.gif) | gasprop.it | 2009-12-22 22:24 | 880K | |
![[SND]](/icons/sound2.gif) | cfejifeffe.it | 2009-08-12 17:12 | 879K | |
![[SND]](/icons/sound2.gif) | facebook.it | 2012-06-30 17:03 | 878K | |
![[SND]](/icons/sound2.gif) | moltres.it | 2011-06-22 19:23 | 874K | |
![[SND]](/icons/sound2.gif) | yestes.it | 2011-01-05 18:01 | 874K | |
![[SND]](/icons/sound2.gif) | backwash.it | 2023-03-26 12:54 | 871K | |
![[SND]](/icons/sound2.gif) | fancy.it | 2008-11-13 19:23 | 869K | |
![[SND]](/icons/sound2.gif) | gregory.it | 2012-09-28 21:40 | 867K | |
![[SND]](/icons/sound2.gif) | nightex.it | 2008-11-16 19:51 | 866K | |
![[SND]](/icons/sound2.gif) | miserati.it | 2007-09-06 18:05 | 863K | |
![[SND]](/icons/sound2.gif) | cusp.it | 2013-06-22 14:06 | 860K | |
![[SND]](/icons/sound2.gif) | tranz.it | 2008-10-23 22:36 | 858K | |
![[SND]](/icons/sound2.gif) | waweway.it | 2022-03-27 13:07 | 856K | |
![[SND]](/icons/sound2.gif) | chuck.it | 2010-03-28 18:06 | 856K | |
![[SND]](/icons/sound2.gif) | dinks.it | 2012-06-25 17:50 | 853K | |
![[SND]](/icons/sound2.gif) | showers.it | 2009-03-29 11:02 | 852K | |
![[SND]](/icons/sound2.gif) | lizardbrain.it | 2022-01-16 13:08 | 851K | |
![[SND]](/icons/sound2.gif) | feedstyle.it | 2023-02-24 17:59 | 850K | |
![[SND]](/icons/sound2.gif) | hedgehog.it | 2010-12-18 17:05 | 848K | |
![[SND]](/icons/sound2.gif) | chops.it | 2008-07-18 20:19 | 847K | |
![[SND]](/icons/sound2.gif) | vibrating.it | 2023-02-22 17:59 | 847K | |
![[SND]](/icons/sound2.gif) | snilly.it | 2022-10-17 18:30 | 845K | |
![[SND]](/icons/sound2.gif) | minestop.it | 2019-04-27 12:28 | 840K | |
![[SND]](/icons/sound2.gif) | muce.it | 2023-09-10 13:06 | 830K | |
![[SND]](/icons/sound2.gif) | ewolwe.it | 2023-02-02 17:58 | 830K | |
![[SND]](/icons/sound2.gif) | lunae dert.it | 2018-11-03 11:23 | 830K | |
![[SND]](/icons/sound2.gif) | slowda.it | 2012-08-25 20:55 | 830K | |
![[SND]](/icons/sound2.gif) | odd.it | 2007-08-28 20:43 | 826K | |
![[SND]](/icons/sound2.gif) | leaky.it | 2022-03-06 13:05 | 825K | |
![[SND]](/icons/sound2.gif) | glittens.it | 2014-01-04 14:09 | 825K | |
![[SND]](/icons/sound2.gif) | reshoot.it | 2023-02-19 13:04 | 821K | |
![[SND]](/icons/sound2.gif) | nuttural.it | 2012-08-22 19:23 | 818K | |
![[SND]](/icons/sound2.gif) | ankler.it | 2013-10-19 14:16 | 816K | |
![[SND]](/icons/sound2.gif) | sashimi.it | 2011-01-22 17:07 | 815K | |
![[SND]](/icons/sound2.gif) | duckblaster.it | 2008-10-14 20:03 | 814K | |
![[SND]](/icons/sound2.gif) | caveshroom.it | 2009-10-07 21:33 | 812K | |
![[SND]](/icons/sound2.gif) | grille.it | 2011-10-26 22:40 | 812K | |
![[SND]](/icons/sound2.gif) | overbright.it | 2011-11-26 17:08 | 809K | |
![[SND]](/icons/sound2.gif) | t.it | 2010-04-09 20:08 | 809K | |
![[SND]](/icons/sound2.gif) | autumn.it | 2008-11-07 21:50 | 808K | |
![[SND]](/icons/sound2.gif) | nutwalker.it | 2012-04-28 16:57 | 799K | |
![[SND]](/icons/sound2.gif) | maxxdenis.it | 2015-07-26 18:17 | 798K | |
![[SND]](/icons/sound2.gif) | shortcircuit.it | 2009-03-28 15:50 | 798K | |
![[SND]](/icons/sound2.gif) | oops.it | 2007-02-22 19:41 | 798K | |
![[SND]](/icons/sound2.gif) | forty.it | 2022-08-14 13:06 | 795K | |
![[SND]](/icons/sound2.gif) | pppp.it | 2009-04-10 21:47 | 793K | |
![[SND]](/icons/sound2.gif) | peachy.it | 2015-06-27 14:08 | 786K | |
![[SND]](/icons/sound2.gif) | makmak.it | 2012-08-09 20:39 | 785K | |
![[SND]](/icons/sound2.gif) | doggers.it | 2011-03-13 22:44 | 784K | |
![[SND]](/icons/sound2.gif) | jacky.it | 2012-07-14 17:07 | 783K | |
![[SND]](/icons/sound2.gif) | bing.it | 2022-09-25 13:02 | 783K | |
![[SND]](/icons/sound2.gif) | dokidoki.it | 2009-02-01 18:22 | 782K | |
![[SND]](/icons/sound2.gif) | valpis.it | 2016-10-21 21:43 | 782K | |
![[SND]](/icons/sound2.gif) | biohazard.it | 2009-03-24 19:47 | 775K | |
![[SND]](/icons/sound2.gif) | buttin.it | 2012-05-05 17:01 | 775K | |
![[SND]](/icons/sound2.gif) | birdbath.it | 2019-03-03 16:16 | 773K | |
![[SND]](/icons/sound2.gif) | spruce.it | 2014-03-01 14:08 | 771K | |
![[SND]](/icons/sound2.gif) | spinef.it | 2008-06-16 01:32 | 768K | |
![[SND]](/icons/sound2.gif) | mump.it | 2015-06-06 21:44 | 767K | |
![[SND]](/icons/sound2.gif) | elhank.it | 2014-03-22 20:06 | 758K | |
![[SND]](/icons/sound2.gif) | bobby.it | 2009-08-07 17:29 | 756K | |
![[SND]](/icons/sound2.gif) | condimentconfig.it | 2013-12-28 14:13 | 755K | |
![[SND]](/icons/sound2.gif) | penguinslament.it | 2009-06-01 17:57 | 752K | |
![[SND]](/icons/sound2.gif) | cheesealpha.it | 2006-11-29 21:48 | 752K | |
![[SND]](/icons/sound2.gif) | pbird.it | 2010-07-27 17:34 | 748K | |
![[SND]](/icons/sound2.gif) | makaha.it | 2011-02-26 18:03 | 746K | |
![[SND]](/icons/sound2.gif) | catemine.it | 2023-02-01 19:54 | 744K | |
![[SND]](/icons/sound2.gif) | nuggeted.it | 2020-06-17 21:16 | 741K | |
![[SND]](/icons/sound2.gif) | rolands.it | 2011-01-02 17:52 | 740K | |
![[SND]](/icons/sound2.gif) | prog.it | 2010-04-04 22:50 | 740K | |
![[SND]](/icons/sound2.gif) | helpme2.it | 2010-10-14 23:22 | 739K | |
![[SND]](/icons/sound2.gif) | weird.it | 2011-01-06 21:29 | 738K | |
![[SND]](/icons/sound2.gif) | seer.it | 2024-03-17 14:04 | 733K | |
![[SND]](/icons/sound2.gif) | duckswinger.it | 2009-04-23 20:14 | 729K | |
![[SND]](/icons/sound2.gif) | wuhwow.it | 2022-07-07 21:16 | 726K | |
![[SND]](/icons/sound2.gif) | sct.it | 2010-12-06 16:24 | 725K | |
![[SND]](/icons/sound2.gif) | adventures.it | 2007-03-14 22:55 | 725K | |
![[SND]](/icons/sound2.gif) | spout.it | 2012-06-25 19:00 | 725K | |
![[SND]](/icons/sound2.gif) | pen15.it | 2009-03-29 14:09 | 724K | |
![[SND]](/icons/sound2.gif) | dumptrain.it | 2014-11-14 19:47 | 723K | |
![[SND]](/icons/sound2.gif) | lintfinger.it | 2012-09-09 16:20 | 722K | |
![[SND]](/icons/sound2.gif) | pootis.it | 2011-12-10 16:34 | 720K | |
![[SND]](/icons/sound2.gif) | ham.it | 2014-05-03 14:09 | 720K | |
![[SND]](/icons/sound2.gif) | mousedog.it | 2012-01-14 17:06 | 719K | |
![[SND]](/icons/sound2.gif) | bulletoctopus.it | 2009-07-17 21:09 | 718K | |
![[SND]](/icons/sound2.gif) | ohyea.it | 2012-04-15 07:29 | 716K | |
![[SND]](/icons/sound2.gif) | triedby11.it | 2009-05-11 19:12 | 714K | |
![[SND]](/icons/sound2.gif) | composition.it | 2009-09-23 20:16 | 712K | |
![[SND]](/icons/sound2.gif) | duckrag.it | 2009-09-17 21:07 | 712K | |
![[SND]](/icons/sound2.gif) | nut_selection.it | 2019-03-05 15:39 | 712K | |
![[SND]](/icons/sound2.gif) | duckromancer.it | 2012-12-13 19:02 | 706K | |
![[SND]](/icons/sound2.gif) | shober.it | 2024-06-26 21:00 | 705K | |
![[SND]](/icons/sound2.gif) | dusty.it | 2008-03-14 22:15 | 704K | |
![[SND]](/icons/sound2.gif) | monster.it | 2009-05-22 17:29 | 704K | |
![[SND]](/icons/sound2.gif) | selfy.it | 2011-01-07 21:46 | 703K | |
![[SND]](/icons/sound2.gif) | friendshouse.it | 2011-07-24 17:01 | 702K | |
![[SND]](/icons/sound2.gif) | mamoic.it | 2010-05-22 23:08 | 701K | |
![[SND]](/icons/sound2.gif) | tempurate.it | 2011-03-26 18:20 | 698K | |
![[SND]](/icons/sound2.gif) | butter2.it | 2006-11-04 19:58 | 698K | |
![[SND]](/icons/sound2.gif) | junkyard.it | 2010-07-29 16:31 | 697K | |
![[SND]](/icons/sound2.gif) | lemongelon.it | 2011-02-27 20:42 | 693K | |
![[SND]](/icons/sound2.gif) | details.it | 2008-11-15 13:41 | 692K | |
![[SND]](/icons/sound2.gif) | reticulum.it | 2010-10-30 17:07 | 685K | |
![[SND]](/icons/sound2.gif) | supretz.it | 2012-06-09 17:03 | 685K | |
![[SND]](/icons/sound2.gif) | bassroach.it | 2009-10-26 21:14 | 684K | |
![[SND]](/icons/sound2.gif) | duckscooter.it | 2010-12-06 19:51 | 682K | |
![[SND]](/icons/sound2.gif) | turnthatshitoff.it | 2014-02-21 15:34 | 679K | |
![[SND]](/icons/sound2.gif) | ANALASS.IT | 2008-07-08 01:56 | 679K | |
![[SND]](/icons/sound2.gif) | bjornholm.it | 2009-03-06 21:14 | 678K | |
![[SND]](/icons/sound2.gif) | beansectors.it | 2009-05-02 13:25 | 678K | |
![[SND]](/icons/sound2.gif) | brother.it | 2021-01-25 22:59 | 676K | |
![[SND]](/icons/sound2.gif) | pizzadog.it | 2011-01-11 17:52 | 676K | |
![[SND]](/icons/sound2.gif) | doo.it | 2008-10-01 19:47 | 676K | |
![[SND]](/icons/sound2.gif) | timewarp.it | 2009-01-15 20:37 | 671K | |
![[SND]](/icons/sound2.gif) | lee.it | 2011-09-10 17:46 | 668K | |
![[SND]](/icons/sound2.gif) | bear.it | 2008-06-24 20:38 | 666K | |
![[SND]](/icons/sound2.gif) | herpderp.it | 2009-06-06 21:27 | 662K | |
![[SND]](/icons/sound2.gif) | megaloaf.it | 2022-01-24 13:00 | 662K | |
![[SND]](/icons/sound2.gif) | wide.it | 2013-03-02 14:10 | 660K | |
![[SND]](/icons/sound2.gif) | cannibal.it | 2008-03-18 22:27 | 660K | |
![[SND]](/icons/sound2.gif) | dingdong.it | 2007-02-20 14:52 | 659K | |
![[SND]](/icons/sound2.gif) | tuneg.it | 2006-08-27 14:19 | 657K | |
![[SND]](/icons/sound2.gif) | beantypo.it | 2009-01-31 16:12 | 652K | |
![[SND]](/icons/sound2.gif) | currypatch.it | 2012-06-27 20:38 | 652K | |
![[SND]](/icons/sound2.gif) | burro.it | 2014-05-19 19:19 | 645K | |
![[SND]](/icons/sound2.gif) | fail.it | 2010-01-18 23:18 | 645K | |
![[SND]](/icons/sound2.gif) | complimentary.it | 2009-02-21 19:05 | 643K | |
![[SND]](/icons/sound2.gif) | yak.it | 2014-07-19 14:11 | 641K | |
![[SND]](/icons/sound2.gif) | brandonizer.it | 2010-01-24 11:37 | 640K | |
![[SND]](/icons/sound2.gif) | rushhour.it | 2008-10-23 19:20 | 640K | |
![[SND]](/icons/sound2.gif) | overland.it | 2010-05-25 22:37 | 634K | |
![[SND]](/icons/sound2.gif) | divergence.it | 2020-05-13 14:52 | 633K | |
![[SND]](/icons/sound2.gif) | oont.it | 2009-12-17 19:55 | 633K | |
![[SND]](/icons/sound2.gif) | potato.it | 2009-09-06 20:07 | 633K | |
![[SND]](/icons/sound2.gif) | ducktheorem.it | 2010-05-26 15:55 | 632K | |
![[SND]](/icons/sound2.gif) | dials.it | 2006-11-08 18:53 | 628K | |
![[SND]](/icons/sound2.gif) | hjv.it | 2008-09-12 20:30 | 628K | |
![[SND]](/icons/sound2.gif) | weiss.it | 2007-08-21 20:43 | 626K | |
![[SND]](/icons/sound2.gif) | warning_pingas.it | 2008-11-09 15:04 | 626K | |
![[SND]](/icons/sound2.gif) | fart.it | 2012-04-11 23:03 | 625K | |
![[SND]](/icons/sound2.gif) | underclocking.it | 2010-02-06 18:57 | 623K | |
![[SND]](/icons/sound2.gif) | chordheimer.it | 2010-11-09 15:52 | 618K | |
![[SND]](/icons/sound2.gif) | papercuts.it | 2009-03-04 20:43 | 615K | |
![[SND]](/icons/sound2.gif) | buttnurds.it | 2014-02-15 21:37 | 609K | |
![[SND]](/icons/sound2.gif) | kakakaka.it | 2008-11-08 17:37 | 609K | |
![[SND]](/icons/sound2.gif) | onionking.it | 2006-11-17 20:21 | 608K | |
![[SND]](/icons/sound2.gif) | chunker.it | 2013-04-13 14:11 | 608K | |
![[SND]](/icons/sound2.gif) | marvelous.it | 2007-12-14 21:37 | 606K | |
![[SND]](/icons/sound2.gif) | polkadot.it | 2013-08-03 14:01 | 604K | |
![[SND]](/icons/sound2.gif) | thepen.it | 2012-01-14 19:36 | 603K | |
![[SND]](/icons/sound2.gif) | excavation.it | 2013-06-08 13:58 | 601K | |
![[SND]](/icons/sound2.gif) | monsquest.it | 2012-06-09 18:39 | 600K | |
![[SND]](/icons/sound2.gif) | tweet.it | 2024-06-30 12:43 | 600K | |
![[SND]](/icons/sound2.gif) | sunset.it | 2010-02-06 16:31 | 598K | |
![[SND]](/icons/sound2.gif) | logicill.it | 2013-07-13 14:10 | 598K | |
![[SND]](/icons/sound2.gif) | geebler.it | 2015-06-05 23:35 | 596K | |
![[SND]](/icons/sound2.gif) | sphynx.it | 2006-11-21 18:29 | 594K | |
![[SND]](/icons/sound2.gif) | unmooring.it | 2014-09-20 14:04 | 594K | |
![[SND]](/icons/sound2.gif) | thirdnut.it | 2012-07-28 17:04 | 592K | |
![[SND]](/icons/sound2.gif) | coolwhisp.it | 2024-08-06 18:01 | 589K | |
![[SND]](/icons/sound2.gif) | alien.it | 2008-04-12 19:51 | 588K | |
![[SND]](/icons/sound2.gif) | jelaycats.it | 2012-08-18 17:08 | 588K | |
![[SND]](/icons/sound2.gif) | accelerando.it | 2009-06-13 17:05 | 587K | |
![[SND]](/icons/sound2.gif) | rgear.it | 2010-05-01 17:06 | 586K | |
![[SND]](/icons/sound2.gif) | denisus.it | 2011-01-10 20:32 | 585K | |
![[SND]](/icons/sound2.gif) | penguin.it | 2008-12-21 12:54 | 585K | |
![[SND]](/icons/sound2.gif) | cinnamon.it | 2008-07-07 22:42 | 585K | |
![[SND]](/icons/sound2.gif) | blue.it | 2009-06-02 17:59 | 584K | |
![[SND]](/icons/sound2.gif) | rp.it | 2007-05-02 15:43 | 583K | |
![[SND]](/icons/sound2.gif) | slugs.it | 2007-04-08 14:05 | 581K | |
![[SND]](/icons/sound2.gif) | qualostinks.it | 2009-06-26 21:10 | 580K | |
![[SND]](/icons/sound2.gif) | randical.it | 2007-03-13 19:57 | 580K | |
![[SND]](/icons/sound2.gif) | blammo.it | 2008-10-31 18:49 | 579K | |
![[SND]](/icons/sound2.gif) | overlord.it | 2010-07-23 22:24 | 577K | |
![[SND]](/icons/sound2.gif) | copying.it | 2021-12-22 14:01 | 576K | |
![[SND]](/icons/sound2.gif) | glutamation.it | 2010-09-21 22:36 | 575K | |
![[SND]](/icons/sound2.gif) | throat_scramble.it | 2020-11-29 14:23 | 574K | |
![[SND]](/icons/sound2.gif) | honeycomb.it | 2006-10-18 15:09 | 573K | |
![[SND]](/icons/sound2.gif) | shrine_mod.it | 2008-12-21 19:20 | 573K | |
![[SND]](/icons/sound2.gif) | zg.it | 2007-06-16 20:27 | 573K | |
![[SND]](/icons/sound2.gif) | shin.it | 2007-09-13 17:09 | 571K | |
![[SND]](/icons/sound2.gif) | dolphins.it | 2010-09-05 18:11 | 570K | |
![[SND]](/icons/sound2.gif) | sally.it | 2008-03-17 15:37 | 568K | |
![[SND]](/icons/sound2.gif) | turtlemaze.it | 2013-11-30 14:08 | 568K | |
![[SND]](/icons/sound2.gif) | dol.it | 2013-01-19 17:11 | 564K | |
![[SND]](/icons/sound2.gif) | garlictime.it | 2013-10-05 14:20 | 562K | |
![[SND]](/icons/sound2.gif) | molex.it | 2009-04-21 20:07 | 561K | |
![[SND]](/icons/sound2.gif) | flambe.it | 2024-04-21 13:16 | 560K | |
![[SND]](/icons/sound2.gif) | metrospread.it | 2012-01-28 17:07 | 560K | |
![[SND]](/icons/sound2.gif) | setblaster.it | 2009-06-14 20:23 | 560K | |
![[SND]](/icons/sound2.gif) | meowcan.it | 2008-06-12 19:25 | 560K | |
![[SND]](/icons/sound2.gif) | axolotl.it | 2010-08-13 18:08 | 559K | |
![[SND]](/icons/sound2.gif) | magic_zipper.it | 2009-09-19 17:04 | 559K | |
![[SND]](/icons/sound2.gif) | madfarts.it | 2010-04-21 23:29 | 557K | |
![[SND]](/icons/sound2.gif) | dual_runner.it | 2011-03-25 20:06 | 556K | |
![[SND]](/icons/sound2.gif) | murduits.it | 2007-12-01 12:49 | 555K | |
![[SND]](/icons/sound2.gif) | goodbar.it | 2009-01-23 16:12 | 555K | |
![[SND]](/icons/sound2.gif) | rentanut.it | 2011-12-24 16:44 | 546K | |
![[SND]](/icons/sound2.gif) | gut.it | 2009-09-08 19:18 | 546K | |
![[SND]](/icons/sound2.gif) | king.it | 2008-06-22 19:38 | 541K | |
![[SND]](/icons/sound2.gif) | treasure.it | 2013-09-28 14:08 | 540K | |
![[SND]](/icons/sound2.gif) | mercurial.it | 2007-06-26 22:00 | 535K | |
![[SND]](/icons/sound2.gif) | sawanegg.it | 2008-10-05 21:44 | 532K | |
![[SND]](/icons/sound2.gif) | lldog.it | 2012-03-04 19:13 | 530K | |
![[SND]](/icons/sound2.gif) | rats.it | 2006-12-09 17:46 | 520K | |
![[SND]](/icons/sound2.gif) | milkrain.it | 2011-03-23 16:01 | 520K | |
![[SND]](/icons/sound2.gif) | islred.it | 2007-06-26 19:29 | 517K | |
![[SND]](/icons/sound2.gif) | firetruck.it | 2009-09-17 19:16 | 516K | |
![[SND]](/icons/sound2.gif) | terminal.it | 2009-06-12 19:47 | 516K | |
![[SND]](/icons/sound2.gif) | sultans.it | 2006-11-22 13:56 | 514K | |
![[SND]](/icons/sound2.gif) | surface.it | 2013-08-10 14:07 | 513K | |
![[SND]](/icons/sound2.gif) | formalparty.it | 2009-09-14 18:54 | 512K | |
![[SND]](/icons/sound2.gif) | flyedpoteto.it | 2005-06-20 19:05 | 512K | |
![[SND]](/icons/sound2.gif) | mutant.it | 2008-11-21 18:20 | 508K | |
![[SND]](/icons/sound2.gif) | slowgo.it | 2009-06-07 17:13 | 507K | |
![[SND]](/icons/sound2.gif) | spinich.it | 2011-10-29 16:06 | 507K | |
![[SND]](/icons/sound2.gif) | rruin.it | 2011-01-29 17:06 | 504K | |
![[SND]](/icons/sound2.gif) | sunday2.it | 2010-12-19 16:57 | 503K | |
![[SND]](/icons/sound2.gif) | vara.it | 2008-05-23 20:51 | 500K | |
![[SND]](/icons/sound2.gif) | xsalad.it | 2009-06-27 20:19 | 500K | |
![[SND]](/icons/sound2.gif) | line6khz.it | 2009-01-31 20:10 | 498K | |
![[SND]](/icons/sound2.gif) | wienerprocess.it | 2010-12-28 21:39 | 496K | |
![[SND]](/icons/sound2.gif) | brownie.it | 2013-12-07 14:40 | 496K | |
![[SND]](/icons/sound2.gif) | bananacon.it | 2010-05-21 22:33 | 495K | |
![[SND]](/icons/sound2.gif) | naut.it | 2024-08-02 09:34 | 490K | |
![[SND]](/icons/sound2.gif) | nuthunters.it | 2012-06-13 11:07 | 488K | |
![[SND]](/icons/sound2.gif) | taming.it | 2023-06-08 19:59 | 487K | |
![[SND]](/icons/sound2.gif) | sparkle.it | 2010-05-09 18:16 | 486K | |
![[SND]](/icons/sound2.gif) | elbowdyne.it | 2006-10-04 18:07 | 485K | |
![[SND]](/icons/sound2.gif) | doopy.it | 2014-01-25 14:04 | 482K | |
![[SND]](/icons/sound2.gif) | refrw.it | 2009-04-20 09:38 | 482K | |
![[SND]](/icons/sound2.gif) | cannolis.it | 2011-05-18 20:06 | 481K | |
![[SND]](/icons/sound2.gif) | overture.it | 2008-05-02 19:09 | 481K | |
![[SND]](/icons/sound2.gif) | porters.it | 2012-12-19 20:46 | 479K | |
![[SND]](/icons/sound2.gif) | sinis.it | 2009-08-20 22:28 | 478K | |
![[SND]](/icons/sound2.gif) | thurty.it | 2024-08-10 17:00 | 477K | |
![[SND]](/icons/sound2.gif) | enterprise.it | 2006-12-08 16:42 | 475K | |
![[SND]](/icons/sound2.gif) | moon.it | 2007-03-31 15:36 | 475K | |
![[SND]](/icons/sound2.gif) | pddp.it | 2008-09-16 21:41 | 475K | |
![[SND]](/icons/sound2.gif) | lateriser.it | 2012-10-13 16:08 | 473K | |
![[SND]](/icons/sound2.gif) | spamdr.it | 2010-11-21 22:48 | 472K | |
![[SND]](/icons/sound2.gif) | diurnal.it | 2011-03-21 22:54 | 471K | |
![[SND]](/icons/sound2.gif) | applesauce.it | 2011-01-28 22:16 | 470K | |
![[SND]](/icons/sound2.gif) | oysters.it | 2008-09-06 18:53 | 468K | |
![[SND]](/icons/sound2.gif) | funky.it | 2006-11-19 17:51 | 467K | |
![[SND]](/icons/sound2.gif) | hjkl.it | 2008-09-04 23:37 | 464K | |
![[SND]](/icons/sound2.gif) | spectrum.it | 2010-08-21 01:09 | 464K | |
![[SND]](/icons/sound2.gif) | amanita.it | 2008-06-17 22:11 | 463K | |
![[SND]](/icons/sound2.gif) | donut.it | 2010-12-04 17:01 | 463K | |
![[SND]](/icons/sound2.gif) | peter.it | 2015-05-24 14:22 | 462K | |
![[SND]](/icons/sound2.gif) | dung.it | 2013-08-31 14:10 | 461K | |
![[SND]](/icons/sound2.gif) | piece.it | 2011-04-01 00:59 | 459K | |
![[SND]](/icons/sound2.gif) | trp.it | 2024-07-24 12:01 | 458K | |
![[SND]](/icons/sound2.gif) | tts.it | 2008-06-02 23:17 | 458K | |
![[SND]](/icons/sound2.gif) | dontstart.it | 2014-02-22 16:19 | 457K | |
![[SND]](/icons/sound2.gif) | grommet.it | 2014-03-08 14:09 | 457K | |
![[SND]](/icons/sound2.gif) | brain.it | 2007-04-16 14:11 | 456K | |
![[SND]](/icons/sound2.gif) | uncharted.it | 2008-04-11 21:05 | 456K | |
![[SND]](/icons/sound2.gif) | lamia.it | 2009-07-31 21:03 | 456K | |
![[SND]](/icons/sound2.gif) | little.it | 2007-03-03 19:04 | 455K | |
![[SND]](/icons/sound2.gif) | casiopealand.it | 2010-03-16 13:19 | 455K | |
![[SND]](/icons/sound2.gif) | guns.it | 2007-12-20 23:55 | 451K | |
![[SND]](/icons/sound2.gif) | dmb.it | 2008-08-15 19:56 | 450K | |
![[SND]](/icons/sound2.gif) | bubbles2.it | 2006-10-21 22:12 | 448K | |
![[SND]](/icons/sound2.gif) | mi.it | 2007-06-08 16:51 | 448K | |
![[SND]](/icons/sound2.gif) | diably.it | 2015-06-10 18:02 | 447K | |
![[SND]](/icons/sound2.gif) | hp.it | 2007-06-24 20:29 | 445K | |
![[SND]](/icons/sound2.gif) | cascade.it | 2011-03-18 20:47 | 445K | |
![[SND]](/icons/sound2.gif) | boros.it | 2007-11-05 19:16 | 445K | |
![[SND]](/icons/sound2.gif) | never.it | 2007-03-23 17:23 | 445K | |
![[SND]](/icons/sound2.gif) | curd.it | 2013-04-20 14:02 | 443K | |
![[SND]](/icons/sound2.gif) | mod.it | 2010-01-16 17:04 | 443K | |
![[SND]](/icons/sound2.gif) | amen.it | 2006-09-03 20:21 | 443K | |
![[SND]](/icons/sound2.gif) | biscuit.it | 2010-10-27 15:06 | 442K | |
![[SND]](/icons/sound2.gif) | copies.it | 2007-11-03 14:22 | 440K | |
![[SND]](/icons/sound2.gif) | facility.it | 2010-06-12 16:07 | 440K | |
![[SND]](/icons/sound2.gif) | speedball.it | 2007-04-17 14:09 | 440K | |
![[SND]](/icons/sound2.gif) | soupchair.it | 2011-01-31 22:41 | 438K | |
![[SND]](/icons/sound2.gif) | ysalad.it | 2010-12-07 00:16 | 436K | |
![[SND]](/icons/sound2.gif) | homper.it | 2011-12-17 17:05 | 434K | |
![[SND]](/icons/sound2.gif) | forest.it | 2006-09-02 17:03 | 430K | |
![[SND]](/icons/sound2.gif) | lexicon.it | 2009-08-07 23:24 | 430K | |
![[SND]](/icons/sound2.gif) | dingo.it | 2011-02-01 23:20 | 430K | |
![[SND]](/icons/sound2.gif) | madventures.it | 2010-07-22 23:55 | 429K | |
![[SND]](/icons/sound2.gif) | yuuuu.it | 2007-03-07 20:41 | 428K | |
![[SND]](/icons/sound2.gif) | crusader.it | 2008-06-23 20:27 | 428K | |
![[SND]](/icons/sound2.gif) | spacemitts.it | 2008-08-08 21:14 | 428K | |
![[SND]](/icons/sound2.gif) | nike.it | 2006-10-12 16:15 | 427K | |
![[SND]](/icons/sound2.gif) | spiner.it | 2012-12-01 17:12 | 425K | |
![[SND]](/icons/sound2.gif) | duckparty.it | 2009-03-05 19:28 | 424K | |
![[SND]](/icons/sound2.gif) | sewerduck.it | 2014-05-20 21:48 | 423K | |
![[SND]](/icons/sound2.gif) | lemonchester.it | 2010-05-12 18:11 | 423K | |
![[SND]](/icons/sound2.gif) | ao.it | 2007-04-14 17:20 | 421K | |
![[SND]](/icons/sound2.gif) | hard.it | 2009-07-26 13:13 | 417K | |
![[SND]](/icons/sound2.gif) | breakfast_lunch.it | 2008-07-12 01:19 | 417K | |
![[SND]](/icons/sound2.gif) | highway.it | 2009-06-10 18:57 | 415K | |
![[SND]](/icons/sound2.gif) | forbidden fluid.it | 2021-01-04 23:00 | 414K | |
![[SND]](/icons/sound2.gif) | overdog.it | 2011-04-02 17:10 | 414K | |
![[SND]](/icons/sound2.gif) | i_missed.it | 2019-02-27 15:15 | 412K | |
![[SND]](/icons/sound2.gif) | farmadv.it | 2009-01-25 19:35 | 410K | |
![[SND]](/icons/sound2.gif) | chemical.it | 2010-01-17 16:38 | 410K | |
![[SND]](/icons/sound2.gif) | bleach.it | 2007-05-18 15:37 | 410K | |
![[SND]](/icons/sound2.gif) | packit.it | 2010-11-05 13:24 | 407K | |
![[SND]](/icons/sound2.gif) | requiem.it | 2008-09-18 23:06 | 407K | |
![[SND]](/icons/sound2.gif) | filet.it | 2006-10-05 19:31 | 406K | |
![[SND]](/icons/sound2.gif) | nose.it | 2014-01-04 16:08 | 406K | |
![[SND]](/icons/sound2.gif) | kkn.it | 2009-05-05 19:43 | 405K | |
![[SND]](/icons/sound2.gif) | siege.it | 2008-09-15 22:11 | 404K | |
![[SND]](/icons/sound2.gif) | thepies.it | 2012-12-15 20:24 | 404K | |
![[SND]](/icons/sound2.gif) | iam.it | 2007-11-08 19:08 | 403K | |
![[SND]](/icons/sound2.gif) | mineral vent.it | 2021-01-29 23:54 | 402K | |
![[SND]](/icons/sound2.gif) | genie.it | 2010-10-05 22:50 | 402K | |
![[SND]](/icons/sound2.gif) | hidden.it | 2008-07-18 23:11 | 401K | |
![[SND]](/icons/sound2.gif) | smacks.it | 2007-06-22 18:52 | 401K | |
![[SND]](/icons/sound2.gif) | newteeth.it | 2011-01-08 17:02 | 401K | |
![[SND]](/icons/sound2.gif) | mounds.it | 2014-02-08 14:50 | 400K | |
![[SND]](/icons/sound2.gif) | wrapple.it | 2011-04-06 17:50 | 400K | |
![[SND]](/icons/sound2.gif) | sparky.it | 2011-01-01 17:11 | 400K | |
![[SND]](/icons/sound2.gif) | phyclassics.it | 2009-06-22 18:02 | 398K | |
![[SND]](/icons/sound2.gif) | KARBY.IT | 2009-07-04 19:03 | 396K | |
![[SND]](/icons/sound2.gif) | sn.it | 2009-06-16 17:42 | 396K | |
![[SND]](/icons/sound2.gif) | nexter.it | 2010-08-23 20:00 | 396K | |
![[SND]](/icons/sound2.gif) | groc.it | 2024-07-20 11:16 | 394K | |
![[SND]](/icons/sound2.gif) | lra.it | 2008-07-20 19:52 | 394K | |
![[SND]](/icons/sound2.gif) | resochmb.it | 2008-07-04 21:19 | 394K | |
![[SND]](/icons/sound2.gif) | frug.it | 2024-05-26 13:03 | 393K | |
![[SND]](/icons/sound2.gif) | grjc.it | 2008-04-11 17:03 | 393K | |
![[SND]](/icons/sound2.gif) | indecision.it | 2008-12-07 21:59 | 392K | |
![[SND]](/icons/sound2.gif) | wrong.it | 2009-11-01 12:25 | 392K | |
![[SND]](/icons/sound2.gif) | grundy.it | 2013-04-27 13:29 | 391K | |
![[SND]](/icons/sound2.gif) | logibread.it | 2011-03-19 01:27 | 391K | |
![[SND]](/icons/sound2.gif) | thrillho.it | 2009-10-31 17:08 | 391K | |
![[SND]](/icons/sound2.gif) | woke.it | 2012-11-03 23:06 | 390K | |
![[SND]](/icons/sound2.gif) | dsteam.it | 2009-08-21 21:45 | 388K | |
![[SND]](/icons/sound2.gif) | true_goats.it | 2011-03-24 20:26 | 388K | |
![[SND]](/icons/sound2.gif) | bonus.it | 2009-04-03 18:01 | 387K | |
![[SND]](/icons/sound2.gif) | sarama.it | 2012-08-20 18:05 | 387K | |
![[SND]](/icons/sound2.gif) | multed.it | 2024-09-08 13:01 | 383K | |
![[SND]](/icons/sound2.gif) | closeencounter.it | 2008-09-24 22:28 | 383K | |
![[SND]](/icons/sound2.gif) | suisse.it | 2010-07-30 19:48 | 383K | |
![[SND]](/icons/sound2.gif) | sanddollar.it | 2007-05-14 19:36 | 380K | |
![[SND]](/icons/sound2.gif) | optimism.it | 2009-09-18 21:49 | 380K | |
![[SND]](/icons/sound2.gif) | escape.it | 2008-10-28 21:40 | 375K | |
![[SND]](/icons/sound2.gif) | carver.it | 2006-11-03 15:14 | 374K | |
![[SND]](/icons/sound2.gif) | mukundle.it | 2009-03-26 20:35 | 373K | |
![[SND]](/icons/sound2.gif) | goblinsetcII.it | 2010-09-25 00:07 | 372K | |
![[SND]](/icons/sound2.gif) | then.it | 2007-06-10 19:40 | 372K | |
![[SND]](/icons/sound2.gif) | saladracer.it | 2011-01-06 22:55 | 370K | |
![[SND]](/icons/sound2.gif) | milkrocket.it | 2010-01-10 18:42 | 368K | |
![[SND]](/icons/sound2.gif) | inid.it | 2010-07-02 20:08 | 368K | |
![[SND]](/icons/sound2.gif) | baconnaise.it | 2009-03-12 19:04 | 367K | |
![[SND]](/icons/sound2.gif) | temperate.it | 2008-05-03 21:10 | 366K | |
![[SND]](/icons/sound2.gif) | garlicmilk.it | 2010-01-16 20:52 | 366K | |
![[SND]](/icons/sound2.gif) | oerg866.it | 2011-07-09 18:05 | 365K | |
![[SND]](/icons/sound2.gif) | bb.it | 2007-08-24 16:17 | 363K | |
![[SND]](/icons/sound2.gif) | chenzyme.it | 2012-09-01 16:56 | 363K | |
![[SND]](/icons/sound2.gif) | manifest.it | 2007-04-15 14:08 | 363K | |
![[SND]](/icons/sound2.gif) | quainor.it | 2009-04-22 20:02 | 362K | |
![[SND]](/icons/sound2.gif) | kwakfest11.it | 2011-11-11 23:55 | 361K | |
![[SND]](/icons/sound2.gif) | blockfarty.it | 2007-04-28 21:23 | 360K | |
![[SND]](/icons/sound2.gif) | crumb.it | 2007-08-30 21:54 | 360K | |
![[SND]](/icons/sound2.gif) | dental.it | 2012-08-23 21:10 | 360K | |
![[SND]](/icons/sound2.gif) | udm.it | 2009-09-08 23:33 | 359K | |
![[SND]](/icons/sound2.gif) | sloth.it | 2010-05-23 21:55 | 358K | |
![[SND]](/icons/sound2.gif) | squirreltrig.it | 2010-11-03 17:33 | 358K | |
![[SND]](/icons/sound2.gif) | qed.it | 2008-11-28 18:06 | 358K | |
![[SND]](/icons/sound2.gif) | devenfury.it | 2009-06-05 18:09 | 356K | |
![[SND]](/icons/sound2.gif) | mazda.it | 2008-05-06 21:48 | 355K | |
![[SND]](/icons/sound2.gif) | sunday.it | 2007-04-14 13:24 | 355K | |
![[SND]](/icons/sound2.gif) | WapikoGenkiYohou.it | 2009-10-07 21:09 | 354K | |
![[SND]](/icons/sound2.gif) | fallout.it | 2008-11-06 22:32 | 352K | |
![[SND]](/icons/sound2.gif) | faerosol.it | 2011-05-08 15:54 | 352K | |
![[SND]](/icons/sound2.gif) | sinesep.it | 2011-07-06 16:23 | 351K | |
![[SND]](/icons/sound2.gif) | conserved.it | 2007-04-10 18:26 | 350K | |
![[SND]](/icons/sound2.gif) | JUPITERV.IT | 2008-09-27 13:17 | 350K | |
![[SND]](/icons/sound2.gif) | asphalt.it | 2006-10-20 15:35 | 350K | |
![[SND]](/icons/sound2.gif) | bumber.it | 2012-06-07 10:49 | 350K | |
![[SND]](/icons/sound2.gif) | mbcs.it | 2009-01-07 17:02 | 349K | |
![[SND]](/icons/sound2.gif) | conf.it | 2007-05-20 14:45 | 348K | |
![[SND]](/icons/sound2.gif) | nowear.it | 2019-10-05 14:02 | 345K | |
![[SND]](/icons/sound2.gif) | calcuda.it | 2007-01-13 22:05 | 344K | |
![[SND]](/icons/sound2.gif) | gone.it | 2007-02-02 20:16 | 343K | |
![[SND]](/icons/sound2.gif) | phony.it | 2006-12-02 17:24 | 343K | |
![[SND]](/icons/sound2.gif) | gunner.it | 2010-09-17 23:37 | 341K | |
![[SND]](/icons/sound2.gif) | dudoodle.it | 2009-11-20 21:27 | 340K | |
![[SND]](/icons/sound2.gif) | stab.it | 2011-03-22 00:59 | 339K | |
![[SND]](/icons/sound2.gif) | curse.it | 2007-12-20 23:55 | 339K | |
![[SND]](/icons/sound2.gif) | gardener.it | 2010-03-12 16:08 | 339K | |
![[SND]](/icons/sound2.gif) | sodamntired.it | 2006-08-07 19:06 | 339K | |
![[SND]](/icons/sound2.gif) | smoothhog.it | 2019-02-19 16:13 | 339K | |
![[SND]](/icons/sound2.gif) | mfc.it | 2008-04-10 22:11 | 338K | |
![[SND]](/icons/sound2.gif) | waste.it | 2011-05-08 23:03 | 337K | |
![[SND]](/icons/sound2.gif) | emily.it | 2010-10-09 17:07 | 337K | |
![[SND]](/icons/sound2.gif) | hd.it | 2007-06-11 18:46 | 337K | |
![[SND]](/icons/sound2.gif) | orinda.it | 2014-01-11 14:07 | 337K | |
![[SND]](/icons/sound2.gif) | donk.it | 2008-11-15 17:16 | 337K | |
![[SND]](/icons/sound2.gif) | goatclock.it | 2009-03-28 00:48 | 335K | |
![[SND]](/icons/sound2.gif) | ssa.it | 2010-07-09 20:53 | 332K | |
![[SND]](/icons/sound2.gif) | sleemp.it | 2021-01-24 22:46 | 331K | |
![[SND]](/icons/sound2.gif) | bouss.it | 2007-03-08 18:27 | 331K | |
![[SND]](/icons/sound2.gif) | bismuth.it | 2009-10-22 19:30 | 330K | |
![[SND]](/icons/sound2.gif) | dunglevan.it | 2015-05-19 20:37 | 329K | |
![[SND]](/icons/sound2.gif) | codabeat.it | 2009-06-27 21:38 | 329K | |
![[SND]](/icons/sound2.gif) | qualopa_original.it | 2009-06-21 17:01 | 325K | |
![[SND]](/icons/sound2.gif) | alflaug.it | 2014-01-31 16:31 | 325K | |
![[SND]](/icons/sound2.gif) | ulake.it | 2007-01-29 19:27 | 324K | |
![[SND]](/icons/sound2.gif) | joliet.it | 2013-01-30 00:03 | 324K | |
![[SND]](/icons/sound2.gif) | gee.it | 2012-07-28 18:40 | 320K | |
![[SND]](/icons/sound2.gif) | library.it | 2006-11-29 19:34 | 320K | |
![[SND]](/icons/sound2.gif) | chadtech.it | 2011-03-13 00:35 | 318K | |
![[SND]](/icons/sound2.gif) | grilt.it | 2022-08-11 16:02 | 317K | |
![[SND]](/icons/sound2.gif) | staco.it | 2022-07-12 21:29 | 316K | |
![[SND]](/icons/sound2.gif) | doot.it | 2010-08-05 22:28 | 316K | |
![[SND]](/icons/sound2.gif) | scrambled.it | 2007-05-04 19:20 | 316K | |
![[SND]](/icons/sound2.gif) | veiner.it | 2010-11-02 22:09 | 315K | |
![[SND]](/icons/sound2.gif) | chorizo.it | 2009-09-20 21:26 | 312K | |
![[SND]](/icons/sound2.gif) | flaking.it | 2010-09-24 21:38 | 311K | |
![[SND]](/icons/sound2.gif) | rubic.it | 2008-07-16 22:23 | 310K | |
![[SND]](/icons/sound2.gif) | bacorn.it | 2008-12-23 20:53 | 308K | |
![[SND]](/icons/sound2.gif) | shrunken.it | 2010-05-15 22:59 | 308K | |
![[SND]](/icons/sound2.gif) | frogule.it | 2011-05-14 18:25 | 306K | |
![[SND]](/icons/sound2.gif) | parrot_tape.it | 2013-09-14 14:03 | 306K | |
![[SND]](/icons/sound2.gif) | dogforge.it | 2011-06-16 19:35 | 304K | |
![[SND]](/icons/sound2.gif) | galaxy.it | 2013-03-23 15:06 | 303K | |
![[SND]](/icons/sound2.gif) | falafel_zone.it | 2008-12-10 22:23 | 303K | |
![[SND]](/icons/sound2.gif) | doilies.it | 2009-01-16 19:39 | 302K | |
![[SND]](/icons/sound2.gif) | cheetahmale.it | 2008-10-25 20:32 | 301K | |
![[SND]](/icons/sound2.gif) | touchsol.it | 2010-06-19 22:02 | 301K | |
![[SND]](/icons/sound2.gif) | roll.it | 2011-03-09 21:45 | 301K | |
![[SND]](/icons/sound2.gif) | hypostation.it | 2021-01-08 23:00 | 300K | |
![[SND]](/icons/sound2.gif) | submarobin.it | 2006-07-31 18:08 | 300K | |
![[SND]](/icons/sound2.gif) | pancakes.it | 2006-08-25 12:42 | 299K | |
![[SND]](/icons/sound2.gif) | memoire.it | 2010-12-06 22:22 | 299K | |
![[SND]](/icons/sound2.gif) | fpf.it | 2007-12-08 20:48 | 298K | |
![[SND]](/icons/sound2.gif) | carrots.it | 2021-01-13 23:04 | 297K | |
![[SND]](/icons/sound2.gif) | tootired.it | 2008-10-24 23:43 | 297K | |
![[SND]](/icons/sound2.gif) | yepnope.it | 2012-05-12 21:04 | 297K | |
![[SND]](/icons/sound2.gif) | alan_merkin.it | 2009-10-18 15:38 | 296K | |
![[SND]](/icons/sound2.gif) | greatwalls.it | 2010-05-16 22:52 | 296K | |
![[SND]](/icons/sound2.gif) | softserve.it | 2010-06-26 16:17 | 294K | |
![[SND]](/icons/sound2.gif) | gruzz.it | 2024-06-09 13:05 | 294K | |
![[SND]](/icons/sound2.gif) | pepperoni.it | 2020-09-07 11:59 | 294K | |
![[SND]](/icons/sound2.gif) | returnaddr.it | 2013-09-21 14:08 | 293K | |
![[SND]](/icons/sound2.gif) | pell.it | 2013-03-09 14:10 | 292K | |
![[SND]](/icons/sound2.gif) | bale.it | 2013-02-09 16:58 | 291K | |
![[SND]](/icons/sound2.gif) | ascelpius.it | 2006-09-26 20:19 | 290K | |
![[SND]](/icons/sound2.gif) | activespoon.it | 2009-03-15 13:35 | 288K | |
![[SND]](/icons/sound2.gif) | daizy.it | 2008-06-15 22:52 | 288K | |
![[SND]](/icons/sound2.gif) | caret.it | 2007-02-25 11:11 | 288K | |
![[SND]](/icons/sound2.gif) | blossom.it | 2007-01-24 20:07 | 288K | |
![[SND]](/icons/sound2.gif) | whtower.it | 2009-07-11 17:06 | 288K | |
![[SND]](/icons/sound2.gif) | ytrewq.it | 2009-10-17 17:07 | 287K | |
![[SND]](/icons/sound2.gif) | nodeleting.it | 2014-08-09 14:07 | 287K | |
![[SND]](/icons/sound2.gif) | dirac.it | 2007-03-17 13:41 | 286K | |
![[SND]](/icons/sound2.gif) | huevon.it | 2009-02-04 20:59 | 285K | |
![[SND]](/icons/sound2.gif) | pux.it | 2008-01-17 19:39 | 285K | |
![[SND]](/icons/sound2.gif) | afd.it | 2008-12-18 21:07 | 284K | |
![[SND]](/icons/sound2.gif) | noflakes.it | 2013-12-14 19:09 | 283K | |
![[SND]](/icons/sound2.gif) | tech.it | 2008-06-18 22:12 | 283K | |
![[SND]](/icons/sound2.gif) | atlantisjr.it | 2007-03-16 15:23 | 282K | |
![[SND]](/icons/sound2.gif) | dizzy.it | 2010-03-30 11:14 | 280K | |
![[SND]](/icons/sound2.gif) | tertiary.it | 2009-09-26 17:05 | 280K | |
![[SND]](/icons/sound2.gif) | yolked.it | 2023-11-19 11:06 | 279K | |
![[SND]](/icons/sound2.gif) | aqueduct.it | 2006-11-06 20:43 | 279K | |
![[SND]](/icons/sound2.gif) | servant.it | 2007-08-06 20:19 | 278K | |
![[SND]](/icons/sound2.gif) | hellom.it | 2007-11-01 20:12 | 278K | |
![[SND]](/icons/sound2.gif) | quartz.it | 2006-10-23 18:08 | 277K | |
![[SND]](/icons/sound2.gif) | argus.it | 2006-11-05 18:09 | 277K | |
![[SND]](/icons/sound2.gif) | wou.it | 2023-11-16 10:18 | 277K | |
![[SND]](/icons/sound2.gif) | siika.it | 2008-08-08 21:14 | 276K | |
![[SND]](/icons/sound2.gif) | wontcha.it | 2009-01-10 16:14 | 275K | |
![[SND]](/icons/sound2.gif) | deep channel.it | 2021-01-16 23:07 | 274K | |
![[SND]](/icons/sound2.gif) | book.it | 2014-03-29 15:06 | 272K | |
![[SND]](/icons/sound2.gif) | chunk.it | 2008-07-04 18:01 | 270K | |
![[SND]](/icons/sound2.gif) | nogghole.it | 2012-10-27 16:05 | 270K | |
![[SND]](/icons/sound2.gif) | capsaicinoid.it | 2011-04-03 17:03 | 270K | |
![[SND]](/icons/sound2.gif) | croque.it | 2009-01-13 20:22 | 270K | |
![[SND]](/icons/sound2.gif) | do.it | 2009-01-10 21:34 | 269K | |
![[SND]](/icons/sound2.gif) | iamsux2.it | 2006-10-29 21:29 | 269K | |
![[SND]](/icons/sound2.gif) | bagelpocket.it | 2012-08-15 18:08 | 268K | |
![[SND]](/icons/sound2.gif) | sidestory.it | 2007-04-01 14:32 | 268K | |
![[SND]](/icons/sound2.gif) | found.it | 2006-10-24 18:06 | 268K | |
![[SND]](/icons/sound2.gif) | burritotech.it | 2009-02-08 19:13 | 268K | |
![[SND]](/icons/sound2.gif) | deboner.it | 2010-10-05 20:25 | 267K | |
![[SND]](/icons/sound2.gif) | artery.it | 2007-08-27 14:36 | 266K | |
![[SND]](/icons/sound2.gif) | wag.it | 2011-01-17 17:39 | 265K | |
![[SND]](/icons/sound2.gif) | roids.it | 2006-08-18 16:09 | 263K | |
![[SND]](/icons/sound2.gif) | hairyball_wip.it | 2010-01-13 20:04 | 263K | |
![[SND]](/icons/sound2.gif) | wteam.it | 2011-07-02 18:09 | 263K | |
![[SND]](/icons/sound2.gif) | bowtie.it | 2006-10-28 22:14 | 263K | |
![[SND]](/icons/sound2.gif) | my_dear_phase_lead.it | 2008-09-05 22:32 | 263K | |
![[SND]](/icons/sound2.gif) | moonrabbit.it | 2011-01-09 18:03 | 262K | |
![[SND]](/icons/sound2.gif) | churro.it | 2010-02-08 18:01 | 260K | |
![[SND]](/icons/sound2.gif) | nunchuk.it | 2010-05-29 16:02 | 259K | |
![[SND]](/icons/sound2.gif) | zxcv.it | 2009-06-08 18:25 | 258K | |
![[SND]](/icons/sound2.gif) | unclean.it | 2011-07-23 17:57 | 257K | |
![[SND]](/icons/sound2.gif) | nyoron.it | 2006-08-24 15:41 | 256K | |
![[SND]](/icons/sound2.gif) | buffer.it | 2011-01-28 20:20 | 256K | |
![[SND]](/icons/sound2.gif) | woudkart.it | 2012-01-21 17:04 | 256K | |
![[SND]](/icons/sound2.gif) | duxolydian.it | 2009-07-31 22:44 | 254K | |
![[SND]](/icons/sound2.gif) | sandcluck.it | 2006-07-26 19:57 | 254K | |
![[SND]](/icons/sound2.gif) | pocketwatch.it | 2012-11-26 17:04 | 251K | |
![[SND]](/icons/sound2.gif) | mimit.it | 2024-12-22 14:00 | 251K | |
![[SND]](/icons/sound2.gif) | chf.it | 2007-01-04 19:13 | 250K | |
![[SND]](/icons/sound2.gif) | steppy.it | 2023-08-19 13:57 | 250K | |
![[SND]](/icons/sound2.gif) | dive.it | 2007-09-15 22:22 | 250K | |
![[SND]](/icons/sound2.gif) | fudge.it | 2021-01-15 23:14 | 250K | |
![[SND]](/icons/sound2.gif) | snowburd.it | 2014-11-29 14:09 | 250K | |
![[SND]](/icons/sound2.gif) | heknows.it | 2006-12-24 20:35 | 249K | |
![[SND]](/icons/sound2.gif) | skype_fix.it | 2009-10-03 17:18 | 249K | |
![[SND]](/icons/sound2.gif) | wilkis.it | 2013-11-02 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | chord3.it | 2020-05-13 18:05 | 248K | |
![[SND]](/icons/sound2.gif) | molebomb.it | 2009-06-20 17:10 | 248K | |
![[SND]](/icons/sound2.gif) | reflux.it | 2011-03-22 21:04 | 248K | |
![[SND]](/icons/sound2.gif) | fallen.it | 2009-04-20 16:37 | 248K | |
![[SND]](/icons/sound2.gif) | kuukan.it | 2007-10-27 21:33 | 248K | |
![[SND]](/icons/sound2.gif) | gfrog.it | 2007-10-05 13:51 | 247K | |
![[SND]](/icons/sound2.gif) | aslsa.it | 2009-01-30 20:19 | 247K | |
![[SND]](/icons/sound2.gif) | northern.it | 2010-12-25 17:06 | 246K | |
![[SND]](/icons/sound2.gif) | taste.it | 2008-09-06 00:19 | 246K | |
![[SND]](/icons/sound2.gif) | badass.it | 2007-06-18 17:14 | 245K | |
![[SND]](/icons/sound2.gif) | powerwrist.it | 2009-02-16 18:08 | 245K | |
![[SND]](/icons/sound2.gif) | procraster.it | 2013-07-06 18:10 | 245K | |
![[SND]](/icons/sound2.gif) | treenuts.it | 2020-05-31 16:29 | 244K | |
![[SND]](/icons/sound2.gif) | handshake.it | 2011-09-24 18:03 | 243K | |
![[SND]](/icons/sound2.gif) | mallardmagic.it | 2009-05-10 18:44 | 243K | |
![[SND]](/icons/sound2.gif) | jstream.it | 2008-02-29 22:48 | 243K | |
![[SND]](/icons/sound2.gif) | niceguy.it | 2008-01-07 20:02 | 241K | |
![[SND]](/icons/sound2.gif) | dgalaxy.it | 2009-08-16 17:11 | 240K | |
![[SND]](/icons/sound2.gif) | mayanp.it | 2008-10-18 21:12 | 240K | |
![[SND]](/icons/sound2.gif) | hacker.it | 2007-04-21 17:25 | 238K | |
![[SND]](/icons/sound2.gif) | redsm.it | 2008-06-02 19:49 | 237K | |
![[SND]](/icons/sound2.gif) | slim.it | 2012-09-22 17:09 | 236K | |
![[SND]](/icons/sound2.gif) | bsae.it | 2009-10-23 21:29 | 236K | |
![[SND]](/icons/sound2.gif) | soulcer.it | 2023-03-18 15:46 | 236K | |
![[SND]](/icons/sound2.gif) | omg.it | 2007-02-07 15:42 | 236K | |
![[SND]](/icons/sound2.gif) | scatfield.it | 2012-12-18 22:09 | 236K | |
![[SND]](/icons/sound2.gif) | apgs.it | 2008-10-30 19:07 | 235K | |
![[SND]](/icons/sound2.gif) | strawberry.it | 2009-05-24 14:27 | 235K | |
![[SND]](/icons/sound2.gif) | mono.it | 2008-08-12 23:08 | 234K | |
![[SND]](/icons/sound2.gif) | loli_weather.it | 2008-10-25 20:33 | 234K | |
![[SND]](/icons/sound2.gif) | antichthones.it | 2010-07-31 15:57 | 233K | |
![[SND]](/icons/sound2.gif) | dishsoap.it | 2006-10-22 21:05 | 232K | |
![[SND]](/icons/sound2.gif) | masters.it | 2007-01-14 18:01 | 231K | |
![[SND]](/icons/sound2.gif) | boc.it | 2007-10-18 19:09 | 231K | |
![[SND]](/icons/sound2.gif) | anomalous.it | 2009-02-09 18:11 | 230K | |
![[SND]](/icons/sound2.gif) | greeblest.it | 2017-08-04 22:05 | 229K | |
![[SND]](/icons/sound2.gif) | rockpopper.it | 2010-07-08 21:13 | 228K | |
![[SND]](/icons/sound2.gif) | wry.it | 2006-11-27 19:26 | 228K | |
![[SND]](/icons/sound2.gif) | candy.it | 2008-03-08 21:03 | 227K | |
![[SND]](/icons/sound2.gif) | scalloped.it | 2007-09-23 20:18 | 225K | |
![[SND]](/icons/sound2.gif) | sensitive.it | 2010-05-20 23:02 | 225K | |
![[SND]](/icons/sound2.gif) | control.it | 2009-10-24 17:10 | 224K | |
![[SND]](/icons/sound2.gif) | uncleBen.it | 2007-02-10 22:45 | 224K | |
![[SND]](/icons/sound2.gif) | iti.it | 2008-12-20 21:40 | 224K | |
![[SND]](/icons/sound2.gif) | bonor.it | 2010-01-22 18:11 | 224K | |
![[SND]](/icons/sound2.gif) | phenomenon.mod | 2008-10-19 15:45 | 223K | |
![[SND]](/icons/sound2.gif) | knob.it | 2010-12-11 17:09 | 222K | |
![[SND]](/icons/sound2.gif) | nice.it | 2007-03-14 16:31 | 222K | |
![[SND]](/icons/sound2.gif) | nutfeast.it | 2011-03-12 23:52 | 221K | |
![[SND]](/icons/sound2.gif) | down.it | 2008-10-16 22:04 | 221K | |
![[SND]](/icons/sound2.gif) | demonarmy.it | 2009-03-10 23:24 | 221K | |
![[SND]](/icons/sound2.gif) | moss.it | 2007-02-25 14:04 | 221K | |
![[SND]](/icons/sound2.gif) | notspace.it | 2007-02-21 14:10 | 220K | |
![[SND]](/icons/sound2.gif) | lastbowl.it | 2013-01-29 04:33 | 219K | |
![[SND]](/icons/sound2.gif) | antibird.it | 2011-01-10 18:20 | 219K | |
![[SND]](/icons/sound2.gif) | aquatic.it | 2006-10-22 17:48 | 218K | |
![[SND]](/icons/sound2.gif) | jumphorse.it | 2012-06-07 04:06 | 217K | |
![[SND]](/icons/sound2.gif) | duckcream.it | 2010-02-21 18:29 | 217K | |
![[SND]](/icons/sound2.gif) | soundcube.it | 2009-03-31 21:20 | 217K | |
![[SND]](/icons/sound2.gif) | milktruck.it | 2009-03-31 19:18 | 215K | |
![[SND]](/icons/sound2.gif) | fish.it | 2008-12-03 20:39 | 215K | |
![[SND]](/icons/sound2.gif) | themducks.it | 2008-11-04 18:55 | 214K | |
![[SND]](/icons/sound2.gif) | inkoddibajs.it | 2009-06-02 15:20 | 214K | |
![[SND]](/icons/sound2.gif) | 4u.it | 2006-11-17 20:20 | 214K | |
![[SND]](/icons/sound2.gif) | harrisv.it | 2010-03-22 21:21 | 214K | |
![[SND]](/icons/sound2.gif) | smergk.it | 2008-12-11 19:15 | 214K | |
![[SND]](/icons/sound2.gif) | umbrella.it | 2009-04-04 18:14 | 213K | |
![[SND]](/icons/sound2.gif) | wgarden.it | 2010-12-29 00:12 | 213K | |
![[SND]](/icons/sound2.gif) | sniffles.it | 2019-02-28 10:46 | 212K | |
![[SND]](/icons/sound2.gif) | hammers.it | 2006-11-18 18:08 | 212K | |
![[SND]](/icons/sound2.gif) | visitors.it | 2007-09-18 18:14 | 212K | |
![[SND]](/icons/sound2.gif) | butman.it | 2024-09-28 11:35 | 211K | |
![[SND]](/icons/sound2.gif) | ifc.it | 2007-11-20 18:59 | 211K | |
![[SND]](/icons/sound2.gif) | fire.it | 2008-10-16 19:45 | 211K | |
![[SND]](/icons/sound2.gif) | sixeight2.it | 2009-06-21 17:53 | 210K | |
![[SND]](/icons/sound2.gif) | automathic.it | 2006-12-09 20:07 | 210K | |
![[SND]](/icons/sound2.gif) | drink.it | 2008-06-21 21:38 | 209K | |
![[SND]](/icons/sound2.gif) | danger.it | 2010-04-06 18:53 | 209K | |
![[SND]](/icons/sound2.gif) | burritocluster.it | 2009-05-02 16:03 | 209K | |
![[SND]](/icons/sound2.gif) | mind.it | 2008-04-30 20:20 | 209K | |
![[SND]](/icons/sound2.gif) | duckscry.it | 2009-06-28 21:57 | 208K | |
![[SND]](/icons/sound2.gif) | hdtw.it | 2008-07-19 19:09 | 208K | |
![[SND]](/icons/sound2.gif) | fufufufufu.it | 2005-12-14 14:05 | 208K | |
![[SND]](/icons/sound2.gif) | ww.it | 2008-12-17 19:36 | 206K | |
![[SND]](/icons/sound2.gif) | due.it | 2008-10-22 19:28 | 206K | |
![[SND]](/icons/sound2.gif) | rahel.it | 2011-07-01 02:27 | 205K | |
![[SND]](/icons/sound2.gif) | spread.it | 2007-08-26 13:07 | 204K | |
![[SND]](/icons/sound2.gif) | afterburn.it | 2013-08-24 14:09 | 201K | |
![[SND]](/icons/sound2.gif) | jsa.it | 2008-11-19 19:02 | 201K | |
![[SND]](/icons/sound2.gif) | votelast.it | 2009-09-30 18:16 | 200K | |
![[SND]](/icons/sound2.gif) | aircond.it | 2008-12-01 19:34 | 200K | |
![[SND]](/icons/sound2.gif) | den.it | 2007-01-14 15:43 | 200K | |
![[SND]](/icons/sound2.gif) | burp.it | 2006-10-27 21:06 | 200K | |
![[SND]](/icons/sound2.gif) | tooth.it | 2007-06-25 14:58 | 200K | |
![[SND]](/icons/sound2.gif) | oop.it | 2009-06-30 21:46 | 199K | |
![[SND]](/icons/sound2.gif) | calcium.it | 2007-05-22 19:29 | 199K | |
![[SND]](/icons/sound2.gif) | buttsores.it | 2012-04-28 22:38 | 198K | |
![[SND]](/icons/sound2.gif) | balcon.it | 2009-01-04 17:32 | 198K | |
![[SND]](/icons/sound2.gif) | vc.it | 2007-07-19 17:10 | 198K | |
![[SND]](/icons/sound2.gif) | buried.it | 2006-11-04 09:37 | 198K | |
![[SND]](/icons/sound2.gif) | bkotn.it | 2010-10-23 17:03 | 196K | |
![[SND]](/icons/sound2.gif) | commun.it | 2010-04-21 21:36 | 196K | |
![[SND]](/icons/sound2.gif) | waaaaaa.it | 2009-10-25 19:13 | 195K | |
![[SND]](/icons/sound2.gif) | chimps.it | 2015-10-18 12:25 | 195K | |
![[SND]](/icons/sound2.gif) | drip_house.it | 2019-03-05 17:11 | 194K | |
![[SND]](/icons/sound2.gif) | scratchbacker.it | 2008-12-28 18:59 | 194K | |
![[SND]](/icons/sound2.gif) | mcmole.it | 2006-06-05 16:17 | 193K | |
![[SND]](/icons/sound2.gif) | botbpack.it | 2010-04-05 11:20 | 192K | |
![[SND]](/icons/sound2.gif) | basement.it | 2007-03-25 14:22 | 192K | |
![[SND]](/icons/sound2.gif) | trianglep.it | 2011-03-19 18:03 | 190K | |
![[SND]](/icons/sound2.gif) | asserole.it | 2005-09-21 16:12 | 190K | |
![[SND]](/icons/sound2.gif) | crystarium.it | 2010-04-06 21:21 | 188K | |
![[SND]](/icons/sound2.gif) | interval.it | 2006-08-20 15:20 | 188K | |
![[SND]](/icons/sound2.gif) | my_midi_baby.it | 2008-10-19 18:27 | 187K | |
![[SND]](/icons/sound2.gif) | moustacheland.it | 2009-03-28 17:48 | 187K | |
![[SND]](/icons/sound2.gif) | srt.it | 2009-04-11 00:08 | 187K | |
![[SND]](/icons/sound2.gif) | hungrytune.it | 2009-09-12 16:57 | 186K | |
![[SND]](/icons/sound2.gif) | gnomecave.it | 2008-03-30 14:31 | 186K | |
![[SND]](/icons/sound2.gif) | minibaggles.it | 2009-05-17 14:48 | 185K | |
![[SND]](/icons/sound2.gif) | sr.it | 2007-09-30 12:05 | 184K | |
![[SND]](/icons/sound2.gif) | saturn.it | 2008-10-18 15:35 | 184K | |
![[SND]](/icons/sound2.gif) | icedcrap.it | 2006-09-01 17:06 | 184K | |
![[SND]](/icons/sound2.gif) | goblinsetc.it | 2006-06-05 19:24 | 183K | |
![[SND]](/icons/sound2.gif) | fog.it | 2007-03-03 15:51 | 183K | |
![[SND]](/icons/sound2.gif) | food_experiment.it | 2009-09-04 23:12 | 183K | |
![[SND]](/icons/sound2.gif) | nytro.it | 2007-08-10 19:59 | 182K | |
![[SND]](/icons/sound2.gif) | tetrahedra.it | 2008-05-14 19:59 | 182K | |
![[SND]](/icons/sound2.gif) | waiting.it | 2014-09-11 21:52 | 181K | |
![[SND]](/icons/sound2.gif) | carpool.it | 2009-01-11 21:11 | 181K | |
![[SND]](/icons/sound2.gif) | songtransfer.it | 2009-01-23 19:40 | 180K | |
![[SND]](/icons/sound2.gif) | koala.it | 2010-01-23 17:03 | 179K | |
![[SND]](/icons/sound2.gif) | truncate.it | 2007-09-07 16:11 | 178K | |
![[SND]](/icons/sound2.gif) | gako.it | 2009-05-31 14:10 | 177K | |
![[SND]](/icons/sound2.gif) | marsburger.it | 2009-11-07 17:00 | 177K | |
![[SND]](/icons/sound2.gif) | manjam.it | 2006-10-04 18:52 | 177K | |
![[SND]](/icons/sound2.gif) | isthenics.it | 2007-04-30 17:19 | 176K | |
![[SND]](/icons/sound2.gif) | computerbreak.it | 2010-07-03 16:05 | 174K | |
![[SND]](/icons/sound2.gif) | 2bits.it | 2006-12-07 13:58 | 174K | |
![[SND]](/icons/sound2.gif) | shitshitshit.it | 2005-08-12 19:00 | 173K | |
![[SND]](/icons/sound2.gif) | created.it | 2006-12-05 16:58 | 173K | |
![[SND]](/icons/sound2.gif) | clover.it | 2012-12-08 16:31 | 172K | |
![[SND]](/icons/sound2.gif) | interlace.it | 2007-04-07 11:30 | 171K | |
![[SND]](/icons/sound2.gif) | hogdo.it | 2008-11-11 20:49 | 169K | |
![[SND]](/icons/sound2.gif) | loupe.it | 2007-06-16 18:04 | 169K | |
![[SND]](/icons/sound2.gif) | metoo.it | 2022-06-11 16:10 | 168K | |
![[SND]](/icons/sound2.gif) | loveduck.it | 2011-02-05 17:50 | 167K | |
![[SND]](/icons/sound2.gif) | ladyfinger.it | 2012-12-22 17:12 | 167K | |
![[SND]](/icons/sound2.gif) | mouldy.it | 2009-03-15 16:42 | 166K | |
![[SND]](/icons/sound2.gif) | beak.it | 2007-05-24 16:35 | 166K | |
![[SND]](/icons/sound2.gif) | casa.it | 2008-09-02 18:55 | 166K | |
![[SND]](/icons/sound2.gif) | quaquaqua.it | 2008-08-12 20:50 | 166K | |
![[SND]](/icons/sound2.gif) | progknife.it | 2010-07-24 16:12 | 166K | |
![[SND]](/icons/sound2.gif) | ihatemusic.it | 2009-07-03 20:30 | 166K | |
![[SND]](/icons/sound2.gif) | furniture.it | 2009-03-13 09:50 | 164K | |
![[SND]](/icons/sound2.gif) | guerilla.it | 2009-06-12 11:52 | 163K | |
![[SND]](/icons/sound2.gif) | esophagus.it | 2010-03-07 21:37 | 163K | |
![[SND]](/icons/sound2.gif) | cabinet.it | 2006-10-25 13:13 | 161K | |
![[SND]](/icons/sound2.gif) | moxylvania.it | 2008-07-20 17:20 | 160K | |
![[SND]](/icons/sound2.gif) | monsquaz_zone.it | 2008-10-29 21:35 | 160K | |
![[SND]](/icons/sound2.gif) | spoon.it | 2009-11-27 18:35 | 159K | |
![[SND]](/icons/sound2.gif) | demanding.it | 2010-03-01 20:32 | 158K | |
![[SND]](/icons/sound2.gif) | fdennis.it | 2011-03-18 23:09 | 157K | |
![[SND]](/icons/sound2.gif) | sandman.it | 2006-10-22 23:23 | 156K | |
![[SND]](/icons/sound2.gif) | solarsail.it | 2009-09-05 17:07 | 155K | |
![[SND]](/icons/sound2.gif) | sentacles.it | 2012-12-25 03:12 | 154K | |
![[SND]](/icons/sound2.gif) | pigs.it | 2006-11-15 17:56 | 153K | |
![[SND]](/icons/sound2.gif) | caliber.it | 2007-09-11 16:08 | 152K | |
![[SND]](/icons/sound2.gif) | ph.it | 2007-07-27 20:05 | 152K | |
![[SND]](/icons/sound2.gif) | toki.it | 2007-01-28 19:16 | 151K | |
![[SND]](/icons/sound2.gif) | wad.it | 2006-11-16 20:11 | 151K | |
![[SND]](/icons/sound2.gif) | durtyburds.it | 2014-09-11 20:03 | 151K | |
![[SND]](/icons/sound2.gif) | burgerball.it | 2023-02-11 17:37 | 150K | |
![[SND]](/icons/sound2.gif) | cove.it | 2007-02-03 20:42 | 149K | |
![[SND]](/icons/sound2.gif) | duckdance.it | 2009-11-21 17:10 | 149K | |
![[SND]](/icons/sound2.gif) | mistified.it | 2008-08-09 11:40 | 149K | |
![[SND]](/icons/sound2.gif) | warmup.it | 2008-09-30 20:08 | 148K | |
![[SND]](/icons/sound2.gif) | dinvamp.it | 2009-05-22 14:16 | 147K | |
![[SND]](/icons/sound2.gif) | rrr.it | 2006-11-01 19:35 | 147K | |
![[SND]](/icons/sound2.gif) | midget_vending_machine.it | 2005-08-17 20:29 | 147K | |
![[SND]](/icons/sound2.gif) | jellybrush.it | 2009-02-13 18:54 | 147K | |
![[SND]](/icons/sound2.gif) | smokin.it | 2008-10-03 20:05 | 145K | |
![[SND]](/icons/sound2.gif) | amiga.it | 2009-02-05 23:34 | 145K | |
![[SND]](/icons/sound2.gif) | dribble.it | 2013-03-16 15:03 | 145K | |
![[SND]](/icons/sound2.gif) | kanjus.it | 2011-02-22 20:23 | 144K | |
![[SND]](/icons/sound2.gif) | mzone.it | 2007-03-18 15:10 | 142K | |
![[SND]](/icons/sound2.gif) | deleting the song data.it | 2021-01-23 23:14 | 141K | |
![[SND]](/icons/sound2.gif) | tacor.it | 2008-08-31 14:01 | 141K | |
![[SND]](/icons/sound2.gif) | beefcase.it | 2006-09-16 21:20 | 141K | |
![[SND]](/icons/sound2.gif) | hive.it | 2007-03-30 17:34 | 140K | |
![[SND]](/icons/sound2.gif) | pastavision.it | 2007-03-09 21:04 | 139K | |
![[SND]](/icons/sound2.gif) | catacombs.it | 2007-03-02 18:58 | 138K | |
![[SND]](/icons/sound2.gif) | crunch.it | 2023-09-22 13:39 | 138K | |
![[SND]](/icons/sound2.gif) | zombine.s3m | 2008-11-13 21:42 | 137K | |
![[SND]](/icons/sound2.gif) | topten.it | 2008-10-22 22:01 | 137K | |
![[SND]](/icons/sound2.gif) | bays.it | 2009-02-15 20:07 | 137K | |
![[SND]](/icons/sound2.gif) | nomf.it | 2009-10-12 13:10 | 137K | |
![[SND]](/icons/sound2.gif) | suture.it | 2011-02-23 20:46 | 136K | |
![[SND]](/icons/sound2.gif) | amigarabbit.it | 2010-05-08 15:53 | 135K | |
![[SND]](/icons/sound2.gif) | retarded.it | 2009-08-15 16:59 | 134K | |
![[SND]](/icons/sound2.gif) | lobsterace.it | 2010-03-20 18:03 | 133K | |
![[SND]](/icons/sound2.gif) | secondbest.it | 2014-04-05 14:13 | 133K | |
![[SND]](/icons/sound2.gif) | beerhall.it | 2009-02-06 19:14 | 132K | |
![[SND]](/icons/sound2.gif) | getchex.it | 2007-05-24 18:57 | 131K | |
![[SND]](/icons/sound2.gif) | vine.it | 2007-02-27 20:25 | 131K | |
![[SND]](/icons/sound2.gif) | mark.it | 2008-03-20 21:51 | 131K | |
![[SND]](/icons/sound2.gif) | meow.it | 2006-10-25 21:58 | 130K | |
![[SND]](/icons/sound2.gif) | another.it | 2006-11-20 17:31 | 130K | |
![[SND]](/icons/sound2.gif) | software.it | 2007-02-08 17:28 | 130K | |
![[SND]](/icons/sound2.gif) | doghand.it | 2021-09-29 09:55 | 130K | |
![[SND]](/icons/sound2.gif) | rage.it | 2007-02-24 12:28 | 128K | |
![[SND]](/icons/sound2.gif) | chipwang.it | 2009-08-22 17:03 | 128K | |
![[SND]](/icons/sound2.gif) | butt_hat.it | 2008-10-25 20:32 | 126K | |
![[SND]](/icons/sound2.gif) | omr.it | 2007-10-21 20:07 | 125K | |
![[SND]](/icons/sound2.gif) | lemon.it | 2007-01-11 21:22 | 125K | |
![[SND]](/icons/sound2.gif) | pastoid.it | 2023-02-12 14:47 | 124K | |
![[SND]](/icons/sound2.gif) | samic.it | 2010-10-16 17:05 | 124K | |
![[SND]](/icons/sound2.gif) | pragma.it | 2013-07-06 14:08 | 123K | |
![[SND]](/icons/sound2.gif) | taqueria.it | 2009-02-05 21:42 | 123K | |
![[SND]](/icons/sound2.gif) | befored.it | 2020-04-11 18:07 | 122K | |
![[SND]](/icons/sound2.gif) | striped.it | 2006-10-21 19:56 | 122K | |
![[SND]](/icons/sound2.gif) | brasstards.it | 2008-05-02 21:23 | 121K | |
![[SND]](/icons/sound2.gif) | bouillon.it | 2007-02-18 17:43 | 121K | |
![[SND]](/icons/sound2.gif) | spepper.it | 2010-03-13 18:03 | 121K | |
![[SND]](/icons/sound2.gif) | fishm.it | 2010-03-05 19:49 | 120K | |
![[SND]](/icons/sound2.gif) | microni.it | 2023-02-17 17:21 | 120K | |
![[SND]](/icons/sound2.gif) | nmbclusters.it | 2007-02-19 16:25 | 120K | |
![[SND]](/icons/sound2.gif) | littleigloo.it | 2008-12-19 22:47 | 120K | |
![[SND]](/icons/sound2.gif) | banana.it | 2008-12-05 20:29 | 120K | |
![[SND]](/icons/sound2.gif) | rabbitland.it | 2009-12-27 14:30 | 119K | |
![[SND]](/icons/sound2.gif) | thegay.it | 2007-03-24 16:23 | 119K | |
![[SND]](/icons/sound2.gif) | rif.it | 2010-03-03 19:16 | 118K | |
![[SND]](/icons/sound2.gif) | penisweather.it | 2009-07-05 19:29 | 118K | |
![[SND]](/icons/sound2.gif) | sinus.it | 2009-05-09 17:06 | 117K | |
![[SND]](/icons/sound2.gif) | downhole.it | 2009-03-10 19:56 | 117K | |
![[SND]](/icons/sound2.gif) | wormwood.it | 2008-03-17 19:26 | 117K | |
![[SND]](/icons/sound2.gif) | crescent.it | 2006-10-27 21:02 | 117K | |
![[SND]](/icons/sound2.gif) | burpmeister.it | 2008-10-24 21:05 | 116K | |
![[SND]](/icons/sound2.gif) | bye.it | 2009-10-26 19:18 | 116K | |
![[SND]](/icons/sound2.gif) | noxiousp.it | 2010-02-13 17:05 | 115K | |
![[SND]](/icons/sound2.gif) | tricell.it | 2009-05-23 20:15 | 115K | |
![[SND]](/icons/sound2.gif) | mrf.it | 2008-07-10 19:07 | 115K | |
![[SND]](/icons/sound2.gif) | bipartite.it | 2009-07-18 18:12 | 114K | |
![[SND]](/icons/sound2.gif) | canned.it | 2006-11-08 16:54 | 114K | |
![[SND]](/icons/sound2.gif) | beef.it | 2008-02-24 22:00 | 112K | |
![[SND]](/icons/sound2.gif) | iglue.it | 2006-10-24 15:30 | 111K | |
![[SND]](/icons/sound2.gif) | redgreen.it | 2006-09-04 18:17 | 110K | |
![[SND]](/icons/sound2.gif) | analbreeze.it | 2009-01-16 23:28 | 109K | |
![[SND]](/icons/sound2.gif) | jul26.it | 2015-07-26 12:57 | 108K | |
![[SND]](/icons/sound2.gif) | dw.it | 2007-07-24 19:37 | 108K | |
![[SND]](/icons/sound2.gif) | wempt.it | 2023-02-18 12:47 | 107K | |
![[SND]](/icons/sound2.gif) | famicookie.it | 2014-02-28 12:07 | 106K | |
![[SND]](/icons/sound2.gif) | meatballsc.it | 2009-02-07 23:36 | 106K | |
![[SND]](/icons/sound2.gif) | norora.it | 2012-12-16 01:21 | 104K | |
![[SND]](/icons/sound2.gif) | crystal_stars.it | 2008-06-16 20:54 | 103K | |
![[SND]](/icons/sound2.gif) | bugs.it | 2006-12-02 20:23 | 103K | |
![[SND]](/icons/sound2.gif) | eatman.it | 2012-06-11 18:17 | 103K | |
![[SND]](/icons/sound2.gif) | acorn.it | 2008-09-06 18:53 | 103K | |
![[SND]](/icons/sound2.gif) | smacken.it | 2009-03-21 19:44 | 102K | |
![[SND]](/icons/sound2.gif) | oh.it | 2009-06-27 22:11 | 101K | |
![[SND]](/icons/sound2.gif) | ducksandal.mod | 2010-07-16 15:43 | 101K | |
![[SND]](/icons/sound2.gif) | l0l.it | 2006-10-16 16:18 | 100K | |
![[SND]](/icons/sound2.gif) | beardrop.it | 2006-11-22 10:37 | 100K | |
![[SND]](/icons/sound2.gif) | pepiga.it | 2021-01-22 23:05 | 99K | |
![[SND]](/icons/sound2.gif) | buttboat.it | 2011-01-27 12:07 | 99K | |
![[SND]](/icons/sound2.gif) | jbdp.it | 2013-08-03 15:57 | 99K | |
![[SND]](/icons/sound2.gif) | hellcave.it | 2008-10-25 20:33 | 98K | |
![[SND]](/icons/sound2.gif) | uchuuduck.it | 2010-01-18 20:23 | 97K | |
![[SND]](/icons/sound2.gif) | furd.it | 2009-07-25 17:08 | 97K | |
![[SND]](/icons/sound2.gif) | outoftime.it | 2006-11-02 12:45 | 97K | |
![[SND]](/icons/sound2.gif) | aniso.it | 2007-12-30 15:13 | 96K | |
![[SND]](/icons/sound2.gif) | doods.it | 2006-11-05 11:57 | 96K | |
![[SND]](/icons/sound2.gif) | slowpoke.it | 2007-04-29 14:08 | 96K | |
![[SND]](/icons/sound2.gif) | dongtrax.it | 2007-01-22 21:16 | 95K | |
![[SND]](/icons/sound2.gif) | mining.it | 2007-02-23 14:22 | 95K | |
![[SND]](/icons/sound2.gif) | blargblarg.it | 2006-09-05 20:24 | 93K | |
![[SND]](/icons/sound2.gif) | aavocado.it | 2009-05-21 22:26 | 91K | |
![[SND]](/icons/sound2.gif) | chrcr.it | 2009-05-06 16:24 | 91K | |
![[SND]](/icons/sound2.gif) | tinkle.it | 2012-12-20 15:28 | 90K | |
![[SND]](/icons/sound2.gif) | deca.it | 2024-12-13 12:46 | 90K | |
![[SND]](/icons/sound2.gif) | compok.it | 2008-12-20 19:26 | 90K | |
![[SND]](/icons/sound2.gif) | badcredits.it | 2007-01-28 20:57 | 89K | |
![[SND]](/icons/sound2.gif) | incompatible.it | 2008-10-25 18:01 | 89K | |
![[SND]](/icons/sound2.gif) | wtf wow bye sorry.it | 2014-05-24 13:31 | 88K | |
![[SND]](/icons/sound2.gif) | wild_skies.it | 2008-11-05 20:00 | 87K | |
![[SND]](/icons/sound2.gif) | truffle_detector.it | 2010-03-22 12:03 | 86K | |
![[SND]](/icons/sound2.gif) | ffii-2.it | 2012-07-29 14:57 | 86K | |
![[SND]](/icons/sound2.gif) | entryvoting3.it | 2022-01-29 23:20 | 86K | |
![[SND]](/icons/sound2.gif) | satellite.it | 2009-01-17 16:08 | 85K | |
![[SND]](/icons/sound2.gif) | semiopteryx.it | 2007-07-22 18:37 | 85K | |
![[SND]](/icons/sound2.gif) | chiptune-wrk.it | 2009-03-12 11:17 | 85K | |
![[SND]](/icons/sound2.gif) | rc.it | 2006-12-23 20:19 | 85K | |
![[SND]](/icons/sound2.gif) | dumpstore.it | 2019-03-02 10:03 | 85K | |
![[SND]](/icons/sound2.gif) | burt.it | 2012-07-18 15:13 | 83K | |
![[SND]](/icons/sound2.gif) | buttchunk.it | 2009-06-20 20:11 | 81K | |
![[SND]](/icons/sound2.gif) | technicanally.it | 2009-02-09 22:09 | 81K | |
![[SND]](/icons/sound2.gif) | scattering foci.it | 2021-01-19 23:12 | 80K | |
![[SND]](/icons/sound2.gif) | dankton.it | 2012-07-13 20:06 | 80K | |
![[SND]](/icons/sound2.gif) | baldus.it | 2010-09-25 17:03 | 80K | |
![[SND]](/icons/sound2.gif) | takoyaki.s3m | 2009-08-17 22:04 | 80K | |
![[SND]](/icons/sound2.gif) | verizon.it | 2008-11-12 21:29 | 79K | |
![[SND]](/icons/sound2.gif) | ofuck.s3m | 2006-09-29 12:35 | 79K | |
![[SND]](/icons/sound2.gif) | acidplane.it | 2007-03-05 18:38 | 79K | |
![[SND]](/icons/sound2.gif) | nfo.it | 2009-05-19 19:08 | 77K | |
![[SND]](/icons/sound2.gif) | omeletto.it | 2010-02-27 19:06 | 77K | |
![[SND]](/icons/sound2.gif) | continue.it | 2009-11-14 16:54 | 77K | |
![[SND]](/icons/sound2.gif) | shinra.it | 2010-04-10 17:06 | 76K | |
![[SND]](/icons/sound2.gif) | trickie.it | 2008-05-08 21:57 | 76K | |
![[SND]](/icons/sound2.gif) | cumulus.it | 2006-07-28 12:02 | 75K | |
![[SND]](/icons/sound2.gif) | nvector.it | 2010-12-13 20:08 | 74K | |
![[SND]](/icons/sound2.gif) | gravywip.s3m | 2008-08-21 22:04 | 73K | |
![[SND]](/icons/sound2.gif) | lovecheese.it | 2009-06-08 22:17 | 71K | |
![[SND]](/icons/sound2.gif) | fistful.it | 2009-01-08 21:05 | 70K | |
![[SND]](/icons/sound2.gif) | surprise.it | 2006-07-25 18:54 | 70K | |
![[SND]](/icons/sound2.gif) | masterchew.it | 2011-01-07 23:48 | 70K | |
![[SND]](/icons/sound2.gif) | bythebook.s3m | 2009-10-09 21:02 | 70K | |
![[SND]](/icons/sound2.gif) | fshort.it | 2007-01-08 12:11 | 69K | |
![[SND]](/icons/sound2.gif) | opal.it | 2010-03-06 17:04 | 68K | |
![[SND]](/icons/sound2.gif) | japani.it | 2010-05-24 21:33 | 68K | |
![[SND]](/icons/sound2.gif) | smellyalater.it | 2013-01-02 15:55 | 67K | |
![[SND]](/icons/sound2.gif) | floppy.it | 2008-10-24 18:52 | 67K | |
![[SND]](/icons/sound2.gif) | skip.it | 2006-10-29 19:17 | 67K | |
![[SND]](/icons/sound2.gif) | wkey.it | 2010-11-06 17:04 | 66K | |
![[SND]](/icons/sound2.gif) | funkyghosty.s3m | 2008-02-11 17:06 | 66K | |
![[SND]](/icons/sound2.gif) | harpood.it | 2010-04-08 19:43 | 66K | |
![[SND]](/icons/sound2.gif) | why.it | 2008-07-08 22:01 | 65K | |
![[SND]](/icons/sound2.gif) | seagull.it | 2009-02-06 22:15 | 65K | |
![[SND]](/icons/sound2.gif) | duxdong.it | 2011-07-12 14:55 | 65K | |
![[SND]](/icons/sound2.gif) | dillpac.it | 2022-06-26 20:20 | 65K | |
![[SND]](/icons/sound2.gif) | pancakehouse.it | 2010-07-10 15:57 | 65K | |
![[SND]](/icons/sound2.gif) | cutegg.it | 2009-02-07 23:33 | 64K | |
![[SND]](/icons/sound2.gif) | rict.it | 2008-12-08 18:19 | 63K | |
![[SND]](/icons/sound2.gif) | how.mod | 2006-10-24 20:03 | 63K | |
![[SND]](/icons/sound2.gif) | beveled.it | 2007-11-28 19:18 | 63K | |
![[SND]](/icons/sound2.gif) | serotonis.s3m | 2008-07-09 20:34 | 61K | |
![[SND]](/icons/sound2.gif) | bitbin_ucdemo2.it | 2012-04-03 16:27 | 61K | |
![[SND]](/icons/sound2.gif) | normaldog.it | 2012-08-02 17:50 | 61K | |
![[SND]](/icons/sound2.gif) | jerk.it | 2013-09-07 15:49 | 61K | |
![[SND]](/icons/sound2.gif) | beach.s3m | 2008-02-26 22:38 | 60K | |
![[SND]](/icons/sound2.gif) | snark.it | 2007-01-05 18:31 | 60K | |
![[SND]](/icons/sound2.gif) | yessopimp.it | 2008-03-17 21:49 | 59K | |
![[SND]](/icons/sound2.gif) | crabs.it | 2008-05-17 16:15 | 59K | |
![[SND]](/icons/sound2.gif) | marblemars.it | 2006-08-26 14:57 | 59K | |
![[SND]](/icons/sound2.gif) | whend.it | 2023-02-02 11:57 | 59K | |
![[SND]](/icons/sound2.gif) | redenbacher.s3m | 2008-07-05 00:55 | 58K | |
![[SND]](/icons/sound2.gif) | nostroke.it | 2013-02-02 17:02 | 58K | |
![[SND]](/icons/sound2.gif) | winer.s3m | 2008-05-01 21:35 | 57K | |
![[SND]](/icons/sound2.gif) | roaddrip.it | 2014-10-18 13:55 | 56K | |
![[SND]](/icons/sound2.gif) | distractions.it | 2006-09-22 20:54 | 55K | |
![[SND]](/icons/sound2.gif) | lonely68.it | 2006-07-28 18:44 | 55K | |
![[SND]](/icons/sound2.gif) | catcow.s3m | 2008-01-20 20:59 | 54K | |
![[SND]](/icons/sound2.gif) | jellies.it | 2006-10-12 18:02 | 53K | |
![[SND]](/icons/sound2.gif) | rfgnomes.it | 2009-09-09 22:55 | 53K | |
![[SND]](/icons/sound2.gif) | wastedtime.it | 2006-10-11 19:30 | 53K | |
![[SND]](/icons/sound2.gif) | free_lsdj_tutorial_easy.it | 2018-05-28 18:22 | 52K | |
![[SND]](/icons/sound2.gif) | gitaigo.it | 2008-11-03 19:39 | 52K | |
![[SND]](/icons/sound2.gif) | pattern.it | 2005-09-26 21:12 | 49K | |
![[SND]](/icons/sound2.gif) | tooshort.it | 2006-10-06 16:20 | 49K | |
![[SND]](/icons/sound2.gif) | tyre.it | 2006-10-29 17:50 | 49K | |
![[SND]](/icons/sound2.gif) | emoji.it | 2011-07-06 23:54 | 48K | |
![[SND]](/icons/sound2.gif) | bugs2.it | 2009-04-04 16:09 | 48K | |
![[SND]](/icons/sound2.gif) | matunnen.it | 2008-09-18 21:08 | 47K | |
![[SND]](/icons/sound2.gif) | inn.it | 2008-10-25 16:17 | 46K | |
![[SND]](/icons/sound2.gif) | starbus.it | 2008-02-28 19:59 | 46K | |
![[SND]](/icons/sound2.gif) | samhain.s3m | 2007-06-16 22:50 | 46K | |
![[SND]](/icons/sound2.gif) | brownworld.it | 2012-07-13 19:01 | 45K | |
![[SND]](/icons/sound2.gif) | classchange.it | 2022-06-19 11:07 | 45K | |
![[SND]](/icons/sound2.gif) | joule.it | 2009-01-17 18:30 | 45K | |
![[SND]](/icons/sound2.gif) | filters.it | 2009-01-24 19:05 | 45K | |
![[SND]](/icons/sound2.gif) | uglies.it | 2006-10-13 15:11 | 44K | |
![[SND]](/icons/sound2.gif) | shiny.it | 2006-09-27 18:10 | 43K | |
![[SND]](/icons/sound2.gif) | infinitedogcode.it | 2012-09-30 19:26 | 43K | |
![[SND]](/icons/sound2.gif) | mildpringle.it | 2012-06-21 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | factory.it | 2007-03-17 18:10 | 41K | |
![[SND]](/icons/sound2.gif) | fortune.it | 2006-07-29 17:49 | 41K | |
![[SND]](/icons/sound2.gif) | cmdr.it | 2007-05-15 19:45 | 41K | |
![[SND]](/icons/sound2.gif) | scrum.it | 2012-07-10 17:14 | 41K | |
![[SND]](/icons/sound2.gif) | move.it | 2008-11-14 22:26 | 41K | |
![[SND]](/icons/sound2.gif) | mdrain.it | 2010-01-09 17:03 | 39K | |
![[SND]](/icons/sound2.gif) | vf.it | 2007-09-30 19:25 | 38K | |
![[SND]](/icons/sound2.gif) | onepattern.it | 2006-11-22 17:41 | 37K | |
![[SND]](/icons/sound2.gif) | dinosores.it | 2006-09-29 12:35 | 37K | |
![[SND]](/icons/sound2.gif) | resonance.it | 2006-09-30 19:57 | 37K | |
![[SND]](/icons/sound2.gif) | sdl.it | 2006-10-11 19:30 | 36K | |
![[SND]](/icons/sound2.gif) | tparadox.it | 2011-01-01 15:17 | 34K | |
![[SND]](/icons/sound2.gif) | jellin.it | 2009-05-17 17:22 | 32K | |
![[SND]](/icons/sound2.gif) | pomodoro.it | 2009-03-07 17:02 | 32K | |
![[SND]](/icons/sound2.gif) | chsalsa.it | 2008-12-27 16:37 | 31K | |
![[SND]](/icons/sound2.gif) | dustcup.it | 2011-03-18 16:39 | 31K | |
![[SND]](/icons/sound2.gif) | grembo.it | 2023-12-03 18:37 | 31K | |
![[SND]](/icons/sound2.gif) | pollen.it | 2007-06-26 18:30 | 30K | |
![[SND]](/icons/sound2.gif) | bg.it | 2007-12-15 00:35 | 29K | |
![[SND]](/icons/sound2.gif) | afternoon.it | 2007-04-18 14:09 | 28K | |
![[SND]](/icons/sound2.gif) | ohnoohnoohno.it | 2012-12-16 14:38 | 27K | |
![[SND]](/icons/sound2.gif) | rosegarden.it | 2007-05-19 21:42 | 27K | |
![[SND]](/icons/sound2.gif) | wingo.it | 2023-11-15 17:01 | 27K | |
![[SND]](/icons/sound2.gif) | infey.it | 2008-11-09 13:07 | 26K | |
![[SND]](/icons/sound2.gif) | cubers.it | 2020-05-01 16:48 | 26K | |
![[SND]](/icons/sound2.gif) | untripped.it | 2006-07-27 19:54 | 26K | |
![[SND]](/icons/sound2.gif) | welf.it | 2024-12-31 19:34 | 26K | |
![[SND]](/icons/sound2.gif) | reggie.it | 2006-08-30 17:15 | 26K | |
![[SND]](/icons/sound2.gif) | different.it | 2006-11-27 21:13 | 25K | |
![[SND]](/icons/sound2.gif) | crunchiest.xm | 2007-12-27 21:45 | 25K | |
![[SND]](/icons/sound2.gif) | gaussy.it | 2022-06-11 20:07 | 23K | |
![[SND]](/icons/sound2.gif) | checking for ohb.it | 2021-11-13 14:33 | 22K | |
![[SND]](/icons/sound2.gif) | chtuna.it | 2008-11-07 19:44 | 21K | |
![[SND]](/icons/sound2.gif) | bankgothic.it | 2008-07-07 20:36 | 21K | |
![[SND]](/icons/sound2.gif) | discovery.it | 2009-05-30 17:06 | 20K | |
![[SND]](/icons/sound2.gif) | backbeard.it | 2007-09-28 19:02 | 20K | |
![[SND]](/icons/sound2.gif) | tonik.it | 2023-11-23 15:44 | 20K | |
![[SND]](/icons/sound2.gif) | calmdown.it | 2020-04-25 18:05 | 19K | |
![[SND]](/icons/sound2.gif) | melodramatic.it | 2008-10-29 19:30 | 15K | |
![[SND]](/icons/sound2.gif) | aj.xm | 2006-10-19 16:37 | 15K | |
![[SND]](/icons/sound2.gif) | the_bottleneck_factory.it | 2012-11-04 14:49 | 15K | |
![[SND]](/icons/sound2.gif) | stingray.it | 2006-09-05 17:37 | 15K | |
![[SND]](/icons/sound2.gif) | animals.it | 2012-10-25 11:13 | 13K | |
![[SND]](/icons/sound2.gif) | western.it | 2007-03-12 18:38 | 13K | |
![[SND]](/icons/sound2.gif) | lovecrack.it | 2023-11-18 15:42 | 12K | |
![[SND]](/icons/sound2.gif) | sine_here.it | 2017-07-22 19:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | runfrombear.it | 2008-11-06 19:52 | 8.3K | |
![[SND]](/icons/sound2.gif) | softest.it | 2012-12-15 00:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | stubby.it | 2006-07-28 09:23 | 7.8K | |
![[SND]](/icons/sound2.gif) | shart.it | 2010-10-21 12:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | goldilocks.it | 2007-03-10 17:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | cutebunn.it | 2007-08-31 23:29 | 5.3K | |
![[SND]](/icons/sound2.gif) | smol4.it | 2020-05-02 16:50 | 4.0K | |
![[SND]](/icons/sound2.gif) | custardpi.it | 2006-07-25 16:47 | 3.9K | |
|